Difference between revisions of "SJ05681"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11281 CPD-11281] == * common-name: ** s-sulfanylglutathione * smiles: ** c(ss)c(c(ncc([o-])...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2751 CPD-2751] == * common-name: ** 5'-hydroxycotinine * smiles: ** c1(=o)(ccc(o)(n(c)1)c2(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2751 CPD-2751] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 5'-hydroxycotinine |
* smiles: | * smiles: | ||
| − | ** | + | ** c1(=o)(ccc(o)(n(c)1)c2(=cn=cc=c2)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** bbnhnzgtkswihd-snvbaglbsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 192.217 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN66-163]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=5'-hydroxycotinine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=bbnhnzgtkswihd-snvbaglbsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=192.217}} |
Revision as of 09:23, 27 August 2019
Contents
Metabolite CPD-2751
- common-name:
- 5'-hydroxycotinine
- smiles:
- c1(=o)(ccc(o)(n(c)1)c2(=cn=cc=c2))
- inchi-key:
- bbnhnzgtkswihd-snvbaglbsa-n
- molecular-weight:
- 192.217
