Difference between revisions of "SJ05706"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6262 CPD-6262] == * common-name: ** a [cys-gly]-s-conjugate == Reaction(s) known to consume...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-GLC-6-P ALPHA-GLC-6-P] == * common-name: ** α-d-glucose 6-phosphate * smiles: ** c(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6262 CPD-6262] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-GLC-6-P ALPHA-GLC-6-P] ==
 
* common-name:
 
* common-name:
** a [cys-gly]-s-conjugate
+
** α-d-glucose 6-phosphate
 +
* smiles:
 +
** c(op(=o)([o-])[o-])c1(oc(o)c(o)c(o)c(o)1)
 +
* inchi-key:
 +
** nbschqhzlsjfnq-dvkngefbsa-l
 +
* molecular-weight:
 +
** 258.121
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-6642]]
+
* [[G6PADH]]
 +
* [[G6PADHh]]
 +
* [[G6PI]]
 +
* [[GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN]]
 +
* [[PGCM]]
 +
* [[PGIA]]
 +
* [[PGIAh]]
 +
* [[PGMTh]]
 +
* [[RXN-15312]]
 +
* [[UG6PGT]]
 +
* [[UG6PGTn]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-6641]]
+
* [[G6PI]]
 +
* [[GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN]]
 +
* [[PGCM]]
 +
* [[PGIA]]
 +
* [[PGIAh]]
 +
* [[PGMTh]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [cys-gly]-s-conjugate}}
+
{{#set: common-name=α-d-glucose 6-phosphate}}
 +
{{#set: inchi-key=inchikey=nbschqhzlsjfnq-dvkngefbsa-l}}
 +
{{#set: molecular-weight=258.121}}

Revision as of 14:20, 26 August 2019

Metabolite ALPHA-GLC-6-P

  • common-name:
    • α-d-glucose 6-phosphate
  • smiles:
    • c(op(=o)([o-])[o-])c1(oc(o)c(o)c(o)c(o)1)
  • inchi-key:
    • nbschqhzlsjfnq-dvkngefbsa-l
  • molecular-weight:
    • 258.121

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality