Difference between revisions of "SJ05706"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-GLC-6-P ALPHA-GLC-6-P] == * common-name: ** α-d-glucose 6-phosphate * smiles: ** c(...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=A-GALACTOSYLCERAMIDE A-GALACTOSYLCERAMIDE] == * common-name: ** a β-d-galactosyl-n-acylsph...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-GLC-6-P ALPHA-GLC-6-P] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=A-GALACTOSYLCERAMIDE A-GALACTOSYLCERAMIDE] ==
 
* common-name:
 
* common-name:
** α-d-glucose 6-phosphate
+
** a β-d-galactosyl-n-acylsphingosine
* smiles:
 
** c(op(=o)([o-])[o-])c1(oc(o)c(o)c(o)c(o)1)
 
* inchi-key:
 
** nbschqhzlsjfnq-dvkngefbsa-l
 
* molecular-weight:
 
** 258.121
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[G6PADH]]
+
* [[RXN-18301]]
* [[G6PADHh]]
+
* [[RXN-18302]]
* [[G6PI]]
 
* [[GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN]]
 
* [[PGCM]]
 
* [[PGIA]]
 
* [[PGIAh]]
 
* [[PGMTh]]
 
* [[RXN-15312]]
 
* [[UG6PGT]]
 
* [[UG6PGTn]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[G6PI]]
 
* [[GLUCOSE-6-PHOSPHATE-1-EPIMERASE-RXN]]
 
* [[PGCM]]
 
* [[PGIA]]
 
* [[PGIAh]]
 
* [[PGMTh]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=α-d-glucose 6-phosphate}}
+
{{#set: common-name=a β-d-galactosyl-n-acylsphingosine}}
{{#set: inchi-key=inchikey=nbschqhzlsjfnq-dvkngefbsa-l}}
 
{{#set: molecular-weight=258.121}}
 

Revision as of 09:24, 27 August 2019

Metabolite A-GALACTOSYLCERAMIDE

  • common-name:
    • a β-d-galactosyl-n-acylsphingosine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality