Difference between revisions of "SJ05741"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NADP NADP] == * common-name: ** nadp+ * smiles: ** c5(=[n+](c1(oc(c(c1o)o)cop(op(occ4(c(c(c(n3(...")
(Created page with "Category:gene == Gene SJ05741 == * transcription-direction: ** negative * right-end-position: ** 113957 * left-end-position: ** 100900 * centisome-position: ** 20.61603...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NADP NADP] ==
+
== Gene SJ05741 ==
−
* common-name:
+
* transcription-direction:
−
** nadp+
+
** negative
−
* smiles:
+
* right-end-position:
−
** c5(=[n+](c1(oc(c(c1o)o)cop(op(occ4(c(c(c(n3(c2(=c(c(=nc=n2)n)n=c3)))o4)op([o-])([o-])=o)o))([o-])=o)(=o)[o-]))c=c(c=c5)c(=o)n)
+
** 113957
−
* inchi-key:
+
* left-end-position:
−
** xjlxinkubywoni-nnyoxohssa-k
+
** 100900
−
* molecular-weight:
+
* centisome-position:
−
** 740.386
+
** 20.61603   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
 +
* [[S.japonica_carotenoid_curated]]
 +
== Reaction(s) associated ==
 
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
−
* [[1.1.1.188-RXN]]
+
* [[3.2.1.21-RXN]]
−
* [[1.1.1.197-RXN]]
+
** Category: [[annotation]]
−
* [[1.1.1.270-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[1.1.1.272-RXN]]
+
* [[3.2.1.58-RXN]]
−
* [[1.1.1.34-RXN]]
+
** Category: [[annotation]]
−
* [[1.18.1.2-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[1.2.1.18-RXN]]
+
** Category: [[orthology]]
−
* [[1.3.1.20-RXN]]
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
−
* [[2.1.1.135-RXN]]
+
* [[RXN-10769]]
−
* [[ALDEHYDE-DEHYDROGENASE-NADP+-RXN]]
+
** Category: [[annotation]]
−
* [[ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[CARBONYL-REDUCTASE-NADPH-RXN]]
+
* [[RXN-10773]]
−
* [[D-XYLOSE-1-DEHYDROGENASE-NADP+-RXN]]
+
** Category: [[annotation]]
−
* [[DIAMINOPIMELATE-DEHYDROGENASE-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[DXPREDISOM-RXN]]
+
* [[RXN-13602]]
−
* [[FLAVONADPREDUCT-RXN]]
+
** Category: [[annotation]]
−
* [[G3PD2]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[G6PADH]]
+
* [[RXN-13603]]
−
* [[G6PADHh]]
+
** Category: [[annotation]]
−
* [[G6PBDH]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[G6PBDHh]]
+
* [[RXN-14179]]
−
* [[GLU6PDEHYDROG-RXN]]
+
** Category: [[annotation]]
−
* [[GLUTDEHYD-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[GLYCEROL-DEHYDROGENASE-NADP+-RXN]]
+
* [[RXN-5341]]
−
* [[HBCO_LPAREN_nadp_RPAREN_]]
+
** Category: [[annotation]]
−
* [[HBCO_LPAREN_nadp_RPAREN_m]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[ISOCITDEH-RXN]]
+
* [[RXN-8036]]
−
* [[L-XYLULOSE-REDUCTASE-RXN]]
+
** Category: [[annotation]]
−
* [[MALIC-NADP-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[METHYLENETHFDEHYDROG-NADP-RXN]]
+
* [[RXN-9674]]
−
* [[N-ACETYLGLUTPREDUCT-RXN]]
+
** Category: [[annotation]]
−
* [[NADPH-DEHYDROGENASE-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[PREPHENATE-DEHYDROGENASE-NADP+-RXN]]
 
−
* [[PROSTAGLANDIN-E2-9-REDUCTASE-RXN]]
 
−
* [[PYRIDOXINE-4-DEHYDROGENASE-RXN]]
 
−
* [[RXN-10841]]
 
−
* [[RXN-1124]]
 
−
* [[RXN-12078]]
 
−
* [[RXN-12267]]
 
−
* [[RXN-12560]]
 
−
* [[RXN-12642]]
 
−
* [[RXN-12645]]
 
−
* [[RXN-12747]]
 
−
* [[RXN-13279]]
 
−
* [[RXN-13279-CPD-14916/NADP//CPD0-2106/NADPH/PROTON.39.]]
 
−
* [[RXN-13686]]
 
−
* [[RXN-13719]]
 
−
* [[RXN-14171]]
 
−
* [[RXN-14209]]
 
−
* [[RXN-14246]]
 
−
* [[RXN-15115]]
 
−
* [[RXN-17773]]
 
−
* [[RXN-17897]]
 
−
* [[RXN-5682]]
 
−
* [[RXN-5822]]
 
−
* [[RXN-6002]]
 
−
* [[RXN-701]]
 
−
* [[RXN-7658]]
 
−
* [[RXN-7659]]
 
−
* [[RXN-7660]]
 
−
* [[RXN-8014]]
 
−
* [[RXN-8772]]
 
−
* [[RXN-8773]]
 
−
* [[RXN-8789]]
 
−
* [[RXN-8790]]
 
−
* [[RXN-8791]]
 
−
* [[RXN-9951]]
 
−
* [[RXN-9952]]
 
−
* [[RXN1F-72]]
 
−
* [[SEPIAPTERIN-REDUCTASE-RXN]]
 
−
* [[SMO]]
 
−
* [[SUCCSEMIALDDEHYDROG-RXN]]
 
−
* [[TRANS-RXN0-277]]
 
−
* [[TROPINE-DEHYDROGENASE-RXN]]
 
 
</div>
 
</div>
−
== Reaction(s) known to produce the compound ==
+
== Pathway(s) associated ==
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[PWY-6788]]
−
* [[1.1.1.188-RXN]]
+
** '''3''' reactions found over '''3''' reactions in the full pathway
−
* [[1.1.1.197-RXN]]
+
* [[PWY-7091]]
−
* [[1.1.1.270-RXN]]
+
** '''2''' reactions found over '''4''' reactions in the full pathway
−
* [[1.1.1.271-RXN]]
+
* [[PWY-7092]]
−
* [[1.1.1.272-RXN]]
+
** '''2''' reactions found over '''3''' reactions in the full pathway
−
* [[1.1.1.34-RXN]]
+
* [[PWY-3121]]
−
* [[1.1.1.64-RXN]]
+
** '''1''' reactions found over '''2''' reactions in the full pathway
−
* [[1.14.13.70-RXN]]
+
* [[PWY-5176]]
−
* [[1.14.13.78-RXN]]
+
** '''1''' reactions found over '''5''' reactions in the full pathway
−
* [[1.14.13.79-RXN]]
+
* [[PWY-6002]]
−
* [[1.14.13.8-RXN]]
+
** '''1''' reactions found over '''2''' reactions in the full pathway
−
* [[1.18.1.2-RXN]]
+
{{#set: transcription-direction=negative}}
−
* [[1.2.1.18-RXN]]
+
{{#set: right-end-position=113957}}
−
* [[1.3.99.5-RXN]]
+
{{#set: left-end-position=100900}}
−
* [[1.5.1.19-RXN]]
+
{{#set: centisome-position=20.61603    }}
−
* [[12-OXOPHYTODIENOATE-REDUCTASE-RXN]]
+
{{#set: organism associated=S.japonica_carotenoid_curated}}
−
* [[2-DEHYDROPANTOATE-REDUCT-RXN]]
+
{{#set: nb reaction associated=10}}
−
* [[2-OCTAPRENYLPHENOL-HYDROX-RXN]]
+
{{#set: nb pathway associated=6}}
−
* [[3-DEHYDROSPHINGANINE-REDUCTASE-RXN]]
 
−
* [[3-HYDROXYBUTYRYL-COA-DEHYDROGENASE-RXN]]
 
−
* [[3-OXOACYL-ACP-REDUCT-RXN]]
 
−
* [[ACETOLACTREDUCTOISOM-RXN]]
 
−
* [[ACETOOHBUTREDUCTOISOM-RXN]]
 
−
* [[ALCDH_LPAREN_nadp_RPAREN_hi]]
 
−
* [[ALCDH_LPAREN_nadp_RPAREN_i]]
 
−
* [[ALCOHOL-DEHYDROGENASE-NADPORNOP+-RXN]]
 
−
* [[AN2PT]]
 
−
* [[ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE-RXN]]
 
−
* [[BTS_LPAREN_nadph_RPAREN_]]
 
−
* [[CARBONYL-REDUCTASE-NADPH-RXN]]
 
−
* [[CHOLESTENONE-5-ALPHA-REDUCTASE-RXN]]
 
−
* [[CORTISONE-ALPHA-REDUCTASE-RXN]]
 
−
* [[D-XYLOSE-1-DEHYDROGENASE-NADP+-RXN]]
 
−
* [[DHFRi]]
 
−
* [[DIAMINOPIMELATE-DEHYDROGENASE-RXN]]
 
−
* [[DIENOYLCOAREDUCT-RXN]]
 
−
* [[DIHYDROFOLATEREDUCT-RXN]]
 
−
* [[DIHYDROKAEMPFEROL-4-REDUCTASE-RXN]]
 
−
* [[DTDPDEHYRHAMREDUCT-RXN]]
 
−
* [[DXPREDISOM-RXN]]
 
−
* [[ENOYL-ACP-REDUCT-NADPH-RXN]]
 
−
* [[FATTY-ACID-SYNTHASE-RXN]]
 
−
* [[FLAVONADPREDUCT-RXN]]
 
−
* [[FOLR2]]
 
−
* [[G3PD2]]
 
−
* [[G5DH]]
 
−
* [[G5DHm]]
 
−
* [[GDR_LPAREN_nadp_RPAREN_]]
 
−
* [[GDR_LPAREN_nadp_RPAREN_h]]
 
−
* [[GDR_LPAREN_nadp_RPAREN_m]]
 
−
* [[GLUCURONATE-REDUCTASE-RXN]]
 
−
* [[GLUTAMATESYN-RXN]]
 
−
* [[GLUTATHIONE-REDUCT-NADPH-RXN]]
 
−
* [[GLUTDEHYD-RXN]]
 
−
* [[GLUTRNAREDUCT-RXN]]
 
−
* [[GLUTSEMIALDEHYDROG-RXN]]
 
−
* [[GLYCEROL-DEHYDROGENASE-NADP+-RXN]]
 
−
* [[GLYOXYLATE-REDUCTASE-NADP+-RXN]]
 
−
* [[GMP-REDUCT-RXN]]
 
−
* [[HBCO_LPAREN_nadp_RPAREN_]]
 
−
* [[HBCO_LPAREN_nadp_RPAREN_m]]
 
−
* [[IDS1]]
 
−
* [[IDS2]]
 
−
* [[ISOCITDEH-RXN]]
 
−
* [[KARI_LPAREN_23dhmb_RPAREN_]]
 
−
* [[KARI_LPAREN_23dhmp_RPAREN_]]
 
−
* [[KYNURENINE-3-MONOOXYGENASE-RXN]]
 
−
* [[L-XYLULOSE-REDUCTASE-RXN]]
 
−
* [[LONG-CHAIN-FATTY-ACYL-COA-REDUCTASE-RXN]]
 
−
* [[MALATE-DEHYDROGENASE-NADP+-RXN]]
 
−
* [[MERCURY-II-REDUCTASE-RXN]]
 
−
* [[METHYLENETHFDEHYDROG-NADP-RXN]]
 
−
* [[MTHFO_LPAREN_nadp_RPAREN_]]
 
−
* [[N-ACETYLGLUTPREDUCT-RXN]]
 
−
* [[NAD-KIN-RXN]]
 
−
* [[NADPH--FERRIHEMOPROTEIN-REDUCTASE-RXN]]
 
−
* [[NADPH-DEHYDROGENASE-FLAVIN-RXN]]
 
−
* [[NADPH-DEHYDROGENASE-RXN]]
 
−
* [[NITRATE-REDUCTASE-NADPH-RXN]]
 
−
* [[NITRIC-OXIDE-SYNTHASE-RXN]]
 
−
* [[NODOy]]
 
−
* [[PROGESTERONE-5-ALPHA-REDUCTASE-RXN]]
 
−
* [[PROSTAGLANDIN-E2-9-REDUCTASE-RXN]]
 
−
* [[PYRIDOXINE-4-DEHYDROGENASE-RXN]]
 
−
* [[PYRNUTRANSHYDROGEN-RXN]]
 
−
* [[QOR-RXN]]
 
−
* [[RETINOLSAT]]
 
−
* [[RIBOFLAVINSYNREDUC-RXN]]
 
−
* [[RXN-10060]]
 
−
* [[RXN-10625]]
 
−
* [[RXN-10655]]
 
−
* [[RXN-10659]]
 
−
* [[RXN-10717]]
 
−
* [[RXN-10740]]
 
−
* [[RXN-10841]]
 
−
* [[RXN-1101]]
 
−
* [[RXN-1102]]
 
−
* [[RXN-1106]]
 
−
* [[RXN-1121]]
 
−
* [[RXN-1124]]
 
−
* [[RXN-1125]]
 
−
* [[RXN-11319]]
 
−
* [[RXN-11476]]
 
−
* [[RXN-11480]]
 
−
* [[RXN-11881]]
 
−
* [[RXN-12078]]
 
−
* [[RXN-12267]]
 
−
* [[RXN-12484]]
 
−
* [[RXN-12510]]
 
−
* [[RXN-12521]]
 
−
* [[RXN-12642]]
 
−
* [[RXN-12645]]
 
−
* [[RXN-12673]]
 
−
* [[RXN-12747]]
 
−
* [[RXN-13008]]
 
−
* [[RXN-13279]]
 
−
* [[RXN-13279-CPD-14916/NADP//CPD0-2106/NADPH/PROTON.39.]]
 
−
* [[RXN-13298]]
 
−
* [[RXN-13299]]
 
−
* [[RXN-13300]]
 
−
* [[RXN-13301]]
 
−
* [[RXN-13307]]
 
−
* [[RXN-13308]]
 
−
* [[RXN-13398]]
 
−
* [[RXN-13431]]
 
−
* [[RXN-13492]]
 
−
* [[RXN-13493]]
 
−
* [[RXN-13494]]
 
−
* [[RXN-13506]]
 
−
* [[RXN-13564]]
 
−
* [[RXN-13565]]
 
−
* [[RXN-13685]]
 
−
* [[RXN-13686]]
 
−
* [[RXN-13707]]
 
−
* [[RXN-13709-4-METHYL-824-CHOLESTADIENOL/NADPH/OXYGEN-MOLECULE/PROTON//CPD-4702/NADP/WATER.78.]]
 
−
* [[RXN-13712-44-DIMETHYL-824-CHOLESTADIENOL/NADPH/OXYGEN-MOLECULE/PROTON//CPD-4577/NADP/WATER.81.]]
 
−
* [[RXN-13719]]
 
−
* [[RXN-13724]]
 
−
* [[RXN-13961]]
 
−
* [[RXN-14023]]
 
−
* [[RXN-14171]]
 
−
* [[RXN-14209]]
 
−
* [[RXN-14246]]
 
−
* [[RXN-14484]]
 
−
* [[RXN-14493]]
 
−
* [[RXN-14715]]
 
−
* [[RXN-14776]]
 
−
* [[RXN-14790]]
 
−
* [[RXN-15006]]
 
−
* [[RXN-15115]]
 
−
* [[RXN-16016]]
 
−
* [[RXN-16017]]
 
−
* [[RXN-16095]]
 
−
* [[RXN-16097]]
 
−
* [[RXN-16112]]
 
−
* [[RXN-16129]]
 
−
* [[RXN-16154]]
 
−
* [[RXN-16616]]
 
−
* [[RXN-16622]]
 
−
* [[RXN-16626]]
 
−
* [[RXN-16630]]
 
−
* [[RXN-17109]]
 
−
* [[RXN-17426]]
 
−
* [[RXN-17427]]
 
−
* [[RXN-17428]]
 
−
* [[RXN-17481]]
 
−
* [[RXN-17482]]
 
−
* [[RXN-17483]]
 
−
* [[RXN-17484]]
 
−
* [[RXN-17525]]
 
−
* [[RXN-17678]]
 
−
* [[RXN-17728]]
 
−
* [[RXN-17773]]
 
−
* [[RXN-17897]]
 
−
* [[RXN-19202]]
 
−
* [[RXN-3142]]
 
−
* [[RXN-4144]]
 
−
* [[RXN-4210]]
 
−
* [[RXN-4225]]
 
−
* [[RXN-4231]]
 
−
* [[RXN-5242]]
 
−
* [[RXN-5285]]
 
−
* [[RXN-5286]]
 
−
* [[RXN-5482]]
 
−
* [[RXN-5901]]
 
−
* [[RXN-600]]
 
−
* [[RXN-701]]
 
−
* [[RXN-707]]
 
−
* [[RXN-711]]
 
−
* [[RXN-715]]
 
−
* [[RXN-7580]]
 
−
* [[RXN-7651]]
 
−
* [[RXN-7658]]
 
−
* [[RXN-7659]]
 
−
* [[RXN-7660]]
 
−
* [[RXN-7664]]
 
−
* [[RXN-7665]]
 
−
* [[RXN-7666]]
 
−
* [[RXN-7676]]
 
−
* [[RXN-7677]]
 
−
* [[RXN-7698]]
 
−
* [[RXN-773]]
 
−
* [[RXN-7784]]
 
−
* [[RXN-7835]]
 
−
* [[RXN-7911]]
 
−
* [[RXN-8772]]
 
−
* [[RXN-8773]]
 
−
* [[RXN-8789]]
 
−
* [[RXN-8790]]
 
−
* [[RXN-8791]]
 
−
* [[RXN-8794]]
 
−
* [[RXN-8795]]
 
−
* [[RXN-8796]]
 
−
* [[RXN-8853]]
 
−
* [[RXN-9514]]
 
−
* [[RXN-9515]]
 
−
* [[RXN-9518]]
 
−
* [[RXN-9521]]
 
−
* [[RXN-9524]]
 
−
* [[RXN-9526]]
 
−
* [[RXN-9528]]
 
−
* [[RXN-9530]]
 
−
* [[RXN-9532]]
 
−
* [[RXN-9534]]
 
−
* [[RXN-9536]]
 
−
* [[RXN-9538]]
 
−
* [[RXN-9540]]
 
−
* [[RXN-9542]]
 
−
* [[RXN-9552]]
 
−
* [[RXN-9556]]
 
−
* [[RXN-9633]]
 
−
* [[RXN-9725]]
 
−
* [[RXN-9951]]
 
−
* [[RXN-9971]]
 
−
* [[RXN0-1281]]
 
−
* [[RXN0-2142]]
 
−
* [[RXN0-5101]]
 
−
* [[RXN1A0-6303]]
 
−
* [[RXN1F-10]]
 
−
* [[RXN1F-160]]
 
−
* [[RXN1F-161]]
 
−
* [[RXN1F-72]]
 
−
* [[RXN1G-157]]
 
−
* [[RXN1G-349]]
 
−
* [[RXN1G-469]]
 
−
* [[RXN1G-508]]
 
−
* [[RXN3O-130]]
 
−
* [[RXN3O-5293]]
 
−
* [[RXN66-11]]
 
−
* [[RXN66-12]]
 
−
* [[RXN66-13]]
 
−
* [[RXN66-14]]
 
−
* [[RXN66-19]]
 
−
* [[RXN66-24]]
 
−
* [[RXN66-27]]
 
−
* [[RXN66-28]]
 
−
* [[RXN66-303]]
 
−
* [[RXN66-304]]
 
−
* [[RXN66-305]]
 
−
* [[RXN66-306]]
 
−
* [[RXN66-314]]
 
−
* [[RXN66-319]]
 
−
* [[RXN66-321]]
 
−
* [[RXN66-323]]
 
−
* [[RXN66-343]]
 
−
* [[RXN66-482]]
 
−
* [[RXN66-81]]
 
−
* [[RXNDQC-2]]
 
−
* [[SEPIAPTERIN-REDUCTASE-RXN]]
 
−
* [[SHIKIMATE-5-DEHYDROGENASE-RXN]]
 
−
* [[SMO]]
 
−
* [[SULFITE-REDUCT-RXN]]
 
−
* [[TDSR]]
 
−
* [[THFOR2]]
 
−
* [[THIOREDOXIN-REDUCT-NADPH-RXN]]
 
−
* [[TRANS-CINNAMATE-4-MONOOXYGENASE-RXN]]
 
−
* [[TRANSENOYLCOARED-RXN]]
 
−
* [[TRANSENOYLCOARED-RXN-CPD-10267/NADP//T2-DECENOYL-COA/NADPH/PROTON.45.]]
 
−
* [[TRANSENOYLCOARED-RXN-HEXANOYL-COA/NADP//CPD0-2121/NADPH/PROTON.42.]]
 
−
* [[TROPINE-DEHYDROGENASE-RXN]]
 
−
* [[UDPNACETYLMURAMATEDEHYDROG-RXN]]
 
−
</div>
 
−
== Reaction(s) of unknown directionality ==
 
−
{{#set: common-name=nadp+}}
 
−
{{#set: inchi-key=inchikey=xjlxinkubywoni-nnyoxohssa-k}}
 
−
{{#set: molecular-weight=740.386}}
 

Latest revision as of 11:02, 18 March 2021

Gene SJ05741

  • transcription-direction:
    • negative
  • right-end-position:
    • 113957
  • left-end-position:
    • 100900
  • centisome-position:
    • 20.61603

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-6788
    • 3 reactions found over 3 reactions in the full pathway
  • PWY-7091
    • 2 reactions found over 4 reactions in the full pathway
  • PWY-7092
    • 2 reactions found over 3 reactions in the full pathway
  • PWY-3121
    • 1 reactions found over 2 reactions in the full pathway
  • PWY-5176
    • 1 reactions found over 5 reactions in the full pathway
  • PWY-6002
    • 1 reactions found over 2 reactions in the full pathway




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ05741&oldid=132295"