Difference between revisions of "SJ05787"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DPG DPG] == * common-name: ** 3-phospho-d-glyceroyl-phosphate * smiles: ** c(c(o)c(op(=o)([o-])...")
(Created page with "Category:gene == Gene SJ05787 == * transcription-direction: ** negative * right-end-position: ** 485089 * left-end-position: ** 469529 * centisome-position: ** 96.30475...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DPG DPG] ==
+
== Gene SJ05787 ==
* common-name:
+
* transcription-direction:
** 3-phospho-d-glyceroyl-phosphate
+
** negative
* smiles:
+
* right-end-position:
** c(c(o)c(op(=o)([o-])[o-])=o)op(=o)([o-])[o-]
+
** 485089
* inchi-key:
+
* left-end-position:
** ljqlqcaxbuheaz-uwtatzphsa-j
+
** 469529
* molecular-weight:
+
* centisome-position:
** 262.006
+
** 96.30475   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[BISPHOSPHOGLYCERATE-MUTASE-RXN]]
+
* [[S.japonica_carotenoid_curated]]
* [[GAPDHSYNEC-RXN]]
+
== Reaction(s) associated ==
* [[GAPDH_]]
+
* [[DISULFOXRED-RXN]]
* [[GAPOXNPHOSPHN-RXN]]
+
** Category: [[annotation]]
* [[PHOSGLYPHOS-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[RXN-17274]]
+
{{#set: transcription-direction=negative}}
== Reaction(s) known to produce the compound ==
+
{{#set: right-end-position=485089}}
* [[GAPDHSYNEC-RXN]]
+
{{#set: left-end-position=469529}}
* [[GAPDH_]]
+
{{#set: centisome-position=96.30475    }}
* [[GAPOXNPHOSPHN-RXN]]
+
{{#set: organism associated=S.japonica_carotenoid_curated}}
* [[PHOSGLYPHOS-RXN]]
+
{{#set: nb reaction associated=1}}
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=3-phospho-d-glyceroyl-phosphate}}
 
{{#set: inchi-key=inchikey=ljqlqcaxbuheaz-uwtatzphsa-j}}
 
{{#set: molecular-weight=262.006}}
 

Latest revision as of 11:02, 18 March 2021

Gene SJ05787

  • transcription-direction:
    • negative
  • right-end-position:
    • 485089
  • left-end-position:
    • 469529
  • centisome-position:
    • 96.30475

Organism(s) associated with this gene

Reaction(s) associated