Difference between revisions of "SJ05787"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-696 CPD-696] == * common-name: ** 24-methylenecycloartanol * smiles: ** cc(c)c(=c)ccc(c)[ch...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DPG DPG] == * common-name: ** 3-phospho-d-glyceroyl-phosphate * smiles: ** c(c(o)c(op(=o)([o-])...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-696 CPD-696] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DPG DPG] ==
 
* common-name:
 
* common-name:
** 24-methylenecycloartanol
+
** 3-phospho-d-glyceroyl-phosphate
 
* smiles:
 
* smiles:
** cc(c)c(=c)ccc(c)[ch]3(ccc4(c)([ch]1(cc[ch]5(c(c)(c)c(o)ccc2(cc12ccc(c)34)5))))
+
** c(c(o)c(op(=o)([o-])[o-])=o)op(=o)([o-])[o-]
 
* inchi-key:
 
* inchi-key:
** bdhqmrxfdyjgii-xpnryqhysa-n
+
** ljqlqcaxbuheaz-uwtatzphsa-j
 
* molecular-weight:
 
* molecular-weight:
** 440.751
+
** 262.006
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[BISPHOSPHOGLYCERATE-MUTASE-RXN]]
 +
* [[GAPDHSYNEC-RXN]]
 +
* [[GAPDH_]]
 +
* [[GAPOXNPHOSPHN-RXN]]
 +
* [[PHOSGLYPHOS-RXN]]
 +
* [[RXN-17274]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-4021]]
+
* [[GAPDHSYNEC-RXN]]
 +
* [[GAPDH_]]
 +
* [[GAPOXNPHOSPHN-RXN]]
 +
* [[PHOSGLYPHOS-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=24-methylenecycloartanol}}
+
{{#set: common-name=3-phospho-d-glyceroyl-phosphate}}
{{#set: inchi-key=inchikey=bdhqmrxfdyjgii-xpnryqhysa-n}}
+
{{#set: inchi-key=inchikey=ljqlqcaxbuheaz-uwtatzphsa-j}}
{{#set: molecular-weight=440.751}}
+
{{#set: molecular-weight=262.006}}

Revision as of 09:24, 27 August 2019

Metabolite DPG

  • common-name:
    • 3-phospho-d-glyceroyl-phosphate
  • smiles:
    • c(c(o)c(op(=o)([o-])[o-])=o)op(=o)([o-])[o-]
  • inchi-key:
    • ljqlqcaxbuheaz-uwtatzphsa-j
  • molecular-weight:
    • 262.006

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality