Difference between revisions of "SJ05827"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SUC-COA SUC-COA] == * common-name: ** succinyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o...")
(Created page with "Category:gene == Gene SJ05827 == * transcription-direction: ** positive * right-end-position: ** 320988 * left-end-position: ** 286400 * centisome-position: ** 58.91719...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SUC-COA SUC-COA] ==
+
== Gene SJ05827 ==
* common-name:
+
* transcription-direction:
** succinyl-coa
+
** positive
* smiles:
+
* right-end-position:
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)ccc(=o)[o-])cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** 320988
* inchi-key:
+
* left-end-position:
** vnoyujkhfwywir-itiydsspsa-i
+
** 286400
* molecular-weight:
+
* centisome-position:
** 862.568
+
** 58.91719   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[AKGDHe2r]]
+
* [[S.japonica_carotenoid_curated]]
* [[HOMSUCTRAN-RXN]]
+
== Reaction(s) associated ==
* [[RXN0-1147]]
+
* [[N-ACETYLTRANSFER-RXN]]
* [[SUCCCOASYN-RXN]]
+
** Category: [[annotation]]
* [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[SUCL_LPAREN_gdp_RPAREN_m]]
+
** Category: [[orthology]]
== Reaction(s) known to produce the compound ==
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
* [[2OXOGLUTARATEDEH-RXN]]
+
* [[RXN0-6948]]
* [[AKGDHe2r]]
+
** Category: [[annotation]]
* [[RXN0-1147]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[SUCCCOASYN-RXN]]
+
** Category: [[orthology]]
* [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
* [[SUCL_LPAREN_gdp_RPAREN_m]]
+
== Pathway(s) associated ==
== Reaction(s) of unknown directionality ==
+
* [[PWY-5154]]
{{#set: common-name=succinyl-coa}}
+
** '''8''' reactions found over '''9''' reactions in the full pathway
{{#set: inchi-key=inchikey=vnoyujkhfwywir-itiydsspsa-i}}
+
* [[ARGSYNBSUB-PWY]]
{{#set: molecular-weight=862.568}}
+
** '''9''' reactions found over '''9''' reactions in the full pathway
 +
* [[GLUTORN-PWY]]
 +
** '''5''' reactions found over '''5''' reactions in the full pathway
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=320988}}
 +
{{#set: left-end-position=286400}}
 +
{{#set: centisome-position=58.91719    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=2}}
 +
{{#set: nb pathway associated=3}}

Latest revision as of 11:04, 18 March 2021

Gene SJ05827

  • transcription-direction:
    • positive
  • right-end-position:
    • 320988
  • left-end-position:
    • 286400
  • centisome-position:
    • 58.91719

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-5154
    • 8 reactions found over 9 reactions in the full pathway
  • ARGSYNBSUB-PWY
    • 9 reactions found over 9 reactions in the full pathway
  • GLUTORN-PWY
    • 5 reactions found over 5 reactions in the full pathway