Difference between revisions of "SJ05827"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SUC-COA SUC-COA] == * common-name: ** succinyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o...")
(Created page with "Category:gene == Gene SJ22546 == * transcription-direction: ** negative * right-end-position: ** 92074 * left-end-position: ** 75653 * centisome-position: ** 43.44877...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SUC-COA SUC-COA] ==
+
== Gene SJ22546 ==
* common-name:
+
* transcription-direction:
** succinyl-coa
+
** negative
* smiles:
+
* right-end-position:
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)ccc(=o)[o-])cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** 92074
* inchi-key:
+
* left-end-position:
** vnoyujkhfwywir-itiydsspsa-i
+
** 75653
* molecular-weight:
+
* centisome-position:
** 862.568
+
** 43.44877   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[AKGDHe2r]]
+
* [[S.japonica_sterols_curated]]
* [[HOMSUCTRAN-RXN]]
+
== Reaction(s) associated ==
* [[RXN0-1147]]
+
* [[RXN-15561]]
* [[SUCCCOASYN-RXN]]
+
** Category: [[annotation]]
* [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[SUCL_LPAREN_gdp_RPAREN_m]]
+
== Pathway(s) associated ==
== Reaction(s) known to produce the compound ==
+
* [[PWY-7511]]
* [[2OXOGLUTARATEDEH-RXN]]
+
** '''7''' reactions found over '''9''' reactions in the full pathway
* [[AKGDHe2r]]
+
{{#set: transcription-direction=negative}}
* [[RXN0-1147]]
+
{{#set: right-end-position=92074}}
* [[SUCCCOASYN-RXN]]
+
{{#set: left-end-position=75653}}
* [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
+
{{#set: centisome-position=43.44877    }}
* [[SUCL_LPAREN_gdp_RPAREN_m]]
+
{{#set: organism associated=S.japonica_sterols_curated}}
== Reaction(s) of unknown directionality ==
+
{{#set: nb reaction associated=1}}
{{#set: common-name=succinyl-coa}}
+
{{#set: nb pathway associated=1}}
{{#set: inchi-key=inchikey=vnoyujkhfwywir-itiydsspsa-i}}
 
{{#set: molecular-weight=862.568}}
 

Revision as of 20:23, 18 December 2020

Gene SJ22546

  • transcription-direction:
    • negative
  • right-end-position:
    • 92074
  • left-end-position:
    • 75653
  • centisome-position:
    • 43.44877

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-7511
    • 7 reactions found over 9 reactions in the full pathway