Difference between revisions of "SJ05887"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-692 CPD-692] == * common-name: ** (+)-cis-abscisic aldehyde * smiles: ** cc(=cc=o)c=cc1(c(c...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LAUROYLCOA-CPD LAUROYLCOA-CPD] == * common-name: ** lauroyl-coa * smiles: ** cccccccccccc(=o)sc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-692 CPD-692] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LAUROYLCOA-CPD LAUROYLCOA-CPD] ==
 
* common-name:
 
* common-name:
** (+)-cis-abscisic aldehyde
+
** lauroyl-coa
 
* smiles:
 
* smiles:
** cc(=cc=o)c=cc1(c(c)(c)cc(=o)c=c(c)1)o
+
** cccccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** rikwdzwvhuiuam-kicrzjjpsa-n
+
** ymcxghlsvalicc-gmhmeamdsa-j
 
* molecular-weight:
 
* molecular-weight:
** 248.321
+
** 945.808
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.2.3.14-RXN]]
+
* [[ACACT6]]
 +
* [[ACACT6h]]
 +
* [[ACOA120OR]]
 +
* [[RXN-14262]]
 +
* [[RXN-9627]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.1.1.288-RXN]]
+
* [[ACACT6]]
 +
* [[RXN-14262]]
 +
* [[RXN-14268]]
 +
* [[RXN-16393]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(+)-cis-abscisic aldehyde}}
+
{{#set: common-name=lauroyl-coa}}
{{#set: inchi-key=inchikey=rikwdzwvhuiuam-kicrzjjpsa-n}}
+
{{#set: inchi-key=inchikey=ymcxghlsvalicc-gmhmeamdsa-j}}
{{#set: molecular-weight=248.321}}
+
{{#set: molecular-weight=945.808}}

Revision as of 09:24, 27 August 2019

Metabolite LAUROYLCOA-CPD

  • common-name:
    • lauroyl-coa
  • smiles:
    • cccccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • ymcxghlsvalicc-gmhmeamdsa-j
  • molecular-weight:
    • 945.808

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality