Difference between revisions of "SJ05913"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLYCEROPHOSPHOGLYCEROL GLYCEROPHOSPHOGLYCEROL] == * common-name: ** glycerophosphoglycerol * sm...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12762 CPD-12762] == * common-name: ** (2e,4e,6e)-2,6-dimethylocta-2,4,6-trienedial * smiles...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLYCEROPHOSPHOGLYCEROL GLYCEROPHOSPHOGLYCEROL] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12762 CPD-12762] ==
 
* common-name:
 
* common-name:
** glycerophosphoglycerol
+
** (2e,4e,6e)-2,6-dimethylocta-2,4,6-trienedial
 
* smiles:
 
* smiles:
** c(c(cop(occ(co)o)([o-])=o)o)o
+
** cc(=cc=o)c=cc=c(c=o)c
 
* inchi-key:
 
* inchi-key:
** llcsxhmjulhsjn-uhfffaoysa-m
+
** ppjgvkzrxchmcc-lnfqzqfxsa-n
 
* molecular-weight:
 
* molecular-weight:
** 245.146
+
** 164.204
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14073]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-11783]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=glycerophosphoglycerol}}
+
{{#set: common-name=(2e,4e,6e)-2,6-dimethylocta-2,4,6-trienedial}}
{{#set: inchi-key=inchikey=llcsxhmjulhsjn-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=ppjgvkzrxchmcc-lnfqzqfxsa-n}}
{{#set: molecular-weight=245.146}}
+
{{#set: molecular-weight=164.204}}

Revision as of 09:23, 27 August 2019

Metabolite CPD-12762

  • common-name:
    • (2e,4e,6e)-2,6-dimethylocta-2,4,6-trienedial
  • smiles:
    • cc(=cc=o)c=cc=c(c=o)c
  • inchi-key:
    • ppjgvkzrxchmcc-lnfqzqfxsa-n
  • molecular-weight:
    • 164.204

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality