Difference between revisions of "SJ05921"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-PANTOATE L-PANTOATE] == * common-name: ** (r)-pantoate * smiles: ** cc(c)(co)c(c([o-])=o)o *...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2189 CPD-2189] == * common-name: ** 1-18:2-2-16:2-monogalactosyldiacylglycerol * smiles: **...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-PANTOATE L-PANTOATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2189 CPD-2189] ==
 
* common-name:
 
* common-name:
** (r)-pantoate
+
** 1-18:2-2-16:2-monogalactosyldiacylglycerol
 
* smiles:
 
* smiles:
** cc(c)(co)c(c([o-])=o)o
+
** cccccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccc=cccccc)=o)=o
 
* inchi-key:
 
* inchi-key:
** otoiipjyvqjatp-bypyzucnsa-m
+
** djvqakqvqxihel-uilgywmgsa-n
 
* molecular-weight:
 
* molecular-weight:
** 147.15
+
** 751.052
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PANTOATE-BETA-ALANINE-LIG-RXN]]
+
* [[RXN-8299]]
 +
* [[RXN-8306]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2-DEHYDROPANTOATE-REDUCT-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(r)-pantoate}}
+
{{#set: common-name=1-18:2-2-16:2-monogalactosyldiacylglycerol}}
{{#set: inchi-key=inchikey=otoiipjyvqjatp-bypyzucnsa-m}}
+
{{#set: inchi-key=inchikey=djvqakqvqxihel-uilgywmgsa-n}}
{{#set: molecular-weight=147.15}}
+
{{#set: molecular-weight=751.052}}

Revision as of 14:19, 26 August 2019

Metabolite CPD-2189

  • common-name:
    • 1-18:2-2-16:2-monogalactosyldiacylglycerol
  • smiles:
    • cccccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccc=cccccc)=o)=o
  • inchi-key:
    • djvqakqvqxihel-uilgywmgsa-n
  • molecular-weight:
    • 751.052

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality