Difference between revisions of "SJ05947"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-29 CPD66-29] == * common-name: ** 5-androstene-3,17-dione * smiles: ** cc24(ccc(=o)cc(=cc...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-5S-5-AMINO-5-CARBOXYPENTANOYL-L-CY N-5S-5-AMINO-5-CARBOXYPENTANOYL-L-CY] == * common-name: **...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-5S-5-AMINO-5-CARBOXYPENTANOYL-L-CY N-5S-5-AMINO-5-CARBOXYPENTANOYL-L-CY] == |
* common-name: | * common-name: | ||
− | ** 5- | + | ** n-[(5s)-5-amino-5-carboxypentanoyl]-l-cysteinyl-d-valine |
* smiles: | * smiles: | ||
− | ** | + | ** cc(c)c(nc(=o)c(nc(=o)cccc([n+])c(=o)[o-])cs)c(=o)[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** byeijzfkoaxbbv-qxewzrgksa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 362.42 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[1.21.3.1-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=5- | + | {{#set: common-name=n-[(5s)-5-amino-5-carboxypentanoyl]-l-cysteinyl-d-valine}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=byeijzfkoaxbbv-qxewzrgksa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=362.42}} |
Revision as of 09:24, 27 August 2019
Contents
Metabolite N-5S-5-AMINO-5-CARBOXYPENTANOYL-L-CY
- common-name:
- n-[(5s)-5-amino-5-carboxypentanoyl]-l-cysteinyl-d-valine
- smiles:
- cc(c)c(nc(=o)c(nc(=o)cccc([n+])c(=o)[o-])cs)c(=o)[o-]
- inchi-key:
- byeijzfkoaxbbv-qxewzrgksa-m
- molecular-weight:
- 362.42
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "n-[(5s)-5-amino-5-carboxypentanoyl]-l-cysteinyl-d-valine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.