Difference between revisions of "SJ05965"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11975 CPD-11975] == * common-name: ** 1-o-(2-acetamido-2-deoxy-α-d-glucopyranosyl)-1d...")
(Created page with "Category:gene == Gene SJ05965 == * transcription-direction: ** negative * right-end-position: ** 128358 * left-end-position: ** 93968 * centisome-position: ** 19.42961...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11975 CPD-11975] ==
+
== Gene SJ05965 ==
−
* common-name:
+
* transcription-direction:
−
** 1-o-(2-acetamido-2-deoxy-α-d-glucopyranosyl)-1d-myo-inositol 3-phosphate
+
** negative
−
* smiles:
+
* right-end-position:
−
** cc(=o)nc2(c(oc1(c(o)c(o)c(o)c(op([o-])(=o)[o-])c(o)1))oc(c(c2o)o)co)
+
** 128358
−
* inchi-key:
+
* left-end-position:
−
** chttvmdqgbocme-dnswdbfxsa-l
+
** 93968
−
* molecular-weight:
+
* centisome-position:
−
** 461.316
+
** 19.42961   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
== Reaction(s) known to produce the compound ==
+
* [[S.japonica_carotenoid_curated]]
−
* [[RXN-6501]]
+
== Reaction(s) associated ==
−
== Reaction(s) of unknown directionality ==
+
* [[3.1.3.16-RXN]]
−
{{#set: common-name=1-o-(2-acetamido-2-deoxy-α-d-glucopyranosyl)-1d-myo-inositol 3-phosphate}}
+
** Category: [[annotation]]
−
{{#set: inchi-key=inchikey=chttvmdqgbocme-dnswdbfxsa-l}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: molecular-weight=461.316}}
+
* [[4-NITROPHENYLPHOSPHATASE-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=128358}}
 +
{{#set: left-end-position=93968}}
 +
{{#set: centisome-position=19.42961    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=2}}

Latest revision as of 11:03, 18 March 2021

Gene SJ05965

  • transcription-direction:
    • negative
  • right-end-position:
    • 128358
  • left-end-position:
    • 93968
  • centisome-position:
    • 19.42961

Organism(s) associated with this gene

Reaction(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ05965&oldid=133004"