Difference between revisions of "SJ05989"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-444 CPD-444] == * common-name: ** s-(methyl-5-thio-α-d-ribose 1-phosphate * smiles: *...")
(Created page with "Category:gene == Gene SJ05989 == * transcription-direction: ** positive * right-end-position: ** 76791 * left-end-position: ** 69347 * centisome-position: ** 81.24253...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-444 CPD-444] ==
+
== Gene SJ05989 ==
* common-name:
+
* transcription-direction:
** s-(methyl-5-thio-α-d-ribose 1-phosphate
+
** positive
* smiles:
+
* right-end-position:
** cscc1(oc(op([o-])(=o)[o-])c(c1o)o)
+
** 76791
* inchi-key:
+
* left-end-position:
** jtfittqbrjdstl-kvtdhhqdsa-l
+
** 69347
* molecular-weight:
+
* centisome-position:
** 258.182
+
** 81.24253   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[5.3.1.23-RXN]]
+
* [[S.japonica_carotenoid_curated]]
* [[M5TRPI]]
+
== Reaction(s) associated ==
== Reaction(s) known to produce the compound ==
+
* [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
* [[M5TAP]]
+
** Category: [[annotation]]
== Reaction(s) of unknown directionality ==
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: common-name=s-(methyl-5-thio-α-d-ribose 1-phosphate}}
+
== Pathway(s) associated ==
{{#set: inchi-key=inchikey=jtfittqbrjdstl-kvtdhhqdsa-l}}
+
* [[PWY-7511]]
{{#set: molecular-weight=258.182}}
+
** '''7''' reactions found over '''9''' reactions in the full pathway
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=76791}}
 +
{{#set: left-end-position=69347}}
 +
{{#set: centisome-position=81.24253    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=1}}
 +
{{#set: nb pathway associated=1}}

Latest revision as of 11:00, 18 March 2021

Gene SJ05989

  • transcription-direction:
    • positive
  • right-end-position:
    • 76791
  • left-end-position:
    • 69347
  • centisome-position:
    • 81.24253

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-7511
    • 7 reactions found over 9 reactions in the full pathway