Difference between revisions of "SJ05989"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17370 CPD-17370] == * common-name: ** 18-hydroxyoleoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-444 CPD-444] == * common-name: ** s-(methyl-5-thio-α-d-ribose 1-phosphate * smiles: *...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-444 CPD-444] == |
* common-name: | * common-name: | ||
| − | ** | + | ** s-(methyl-5-thio-α-d-ribose 1-phosphate |
* smiles: | * smiles: | ||
| − | ** | + | ** cscc1(oc(op([o-])(=o)[o-])c(c1o)o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** jtfittqbrjdstl-kvtdhhqdsa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 258.182 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[5.3.1.23-RXN]] |
| + | * [[M5TRPI]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[M5TAP]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=s-(methyl-5-thio-α-d-ribose 1-phosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=jtfittqbrjdstl-kvtdhhqdsa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=258.182}} |
Revision as of 14:19, 26 August 2019
Contents
Metabolite CPD-444
- common-name:
- s-(methyl-5-thio-α-d-ribose 1-phosphate
- smiles:
- cscc1(oc(op([o-])(=o)[o-])c(c1o)o)
- inchi-key:
- jtfittqbrjdstl-kvtdhhqdsa-l
- molecular-weight:
- 258.182
