Difference between revisions of "SJ05994"

Revision as of 09:23, 27 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7000 CPD-7000] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CDP CDP] ==
 * common-name:
-** isobutanal
+** cdp
 * smiles:
-** cc(c)[ch]=o
+** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))op(op([o-])([o-])=o)([o-])=o
 * inchi-key:
-** amimrnsirudhcm-uhfffaoysa-n
+** zwiadyzpowuwew-xvfcmesisa-k
 * molecular-weight:
-** 72.107
+** 400.155
 == Reaction(s) known to consume the compound ==
-* [[RXN-7657]]
+* [[ATCD]]
+* [[ATCDm]]
+* [[CDPKIN-RXN]]
+* [[CDPREDUCT-RXN]]
+* [[DCDT]]
+* [[RIBONUCLEOSIDE-DIP-REDUCTII-RXN]]
+* [[RXN-12198]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-7657]]
+* [[ATCM]]
+* [[DOLICHOL-KINASE-RXN]]
+* [[RXN-11832]]
+* [[RXN-12195]]
+* [[RXN-12959]]
+* [[RXN-15091]]
+* [[RXN-7683]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=isobutanal}}
+{{#set: common-name=cdp}}
-{{#set: inchi-key=inchikey=amimrnsirudhcm-uhfffaoysa-n}}
+{{#set: inchi-key=inchikey=zwiadyzpowuwew-xvfcmesisa-k}}
-{{#set: molecular-weight=72.107}}
+{{#set: molecular-weight=400.155}}