Difference between revisions of "SJ05994"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CDP CDP] == * common-name: ** cdp * smiles: ** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))op(op([o-...")
(Created page with "Category:gene == Gene SJ18177 == * transcription-direction: ** negative * right-end-position: ** 186007 * left-end-position: ** 180048 * centisome-position: ** 71.5945...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CDP CDP] ==
+
== Gene SJ18177 ==
* common-name:
+
* transcription-direction:
** cdp
+
** negative
* smiles:
+
* right-end-position:
** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))op(op([o-])([o-])=o)([o-])=o
+
** 186007
* inchi-key:
+
* left-end-position:
** zwiadyzpowuwew-xvfcmesisa-k
+
** 180048
* molecular-weight:
+
* centisome-position:
** 400.155
+
** 71.5945   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[ATCD]]
+
* [[S.japonica_sterols_curated]]
* [[ATCDm]]
+
== Reaction(s) associated ==
* [[CDPKIN-RXN]]
+
* [[GLYCINE-N-METHYLTRANSFERASE-RXN]]
* [[CDPREDUCT-RXN]]
+
** Category: [[annotation]]
* [[DCDT]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[RIBONUCLEOSIDE-DIP-REDUCTII-RXN]]
+
* [[RXN-13404]]
* [[RXN-12198]]
+
** Category: [[annotation]]
== Reaction(s) known to produce the compound ==
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[ATCM]]
+
* [[RXN-13405]]
* [[DOLICHOL-KINASE-RXN]]
+
** Category: [[annotation]]
* [[RXN-11832]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[RXN-12195]]
+
* [[RXN-13406]]
* [[RXN-12959]]
+
** Category: [[annotation]]
* [[RXN-15091]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[RXN-7683]]
+
* [[RXN-9679]]
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
{{#set: common-name=cdp}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: inchi-key=inchikey=zwiadyzpowuwew-xvfcmesisa-k}}
+
* [[RXN-9680]]
{{#set: molecular-weight=400.155}}
+
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
== Pathway(s) associated ==
 +
* [[P541-PWY]]
 +
** '''3''' reactions found over '''3''' reactions in the full pathway
 +
* [[PWY-6004]]
 +
** '''3''' reactions found over '''3''' reactions in the full pathway
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=186007}}
 +
{{#set: left-end-position=180048}}
 +
{{#set: centisome-position=71.5945    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=6}}
 +
{{#set: nb pathway associated=2}}

Revision as of 20:19, 18 December 2020

Gene SJ18177

  • transcription-direction:
    • negative
  • right-end-position:
    • 186007
  • left-end-position:
    • 180048
  • centisome-position:
    • 71.5945

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • P541-PWY
    • 3 reactions found over 3 reactions in the full pathway
  • PWY-6004
    • 3 reactions found over 3 reactions in the full pathway