Difference between revisions of "SJ05994"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7000 CPD-7000] == * common-name: ** isobutanal * smiles: ** cc(c)[ch]=o * inchi-key: ** ami...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CDP CDP] == * common-name: ** cdp * smiles: ** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))op(op([o-...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CDP CDP] == |
* common-name: | * common-name: | ||
− | ** | + | ** cdp |
* smiles: | * smiles: | ||
− | ** | + | ** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))op(op([o-])([o-])=o)([o-])=o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** zwiadyzpowuwew-xvfcmesisa-k |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 400.155 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[ATCD]] |
+ | * [[ATCDm]] | ||
+ | * [[CDPKIN-RXN]] | ||
+ | * [[CDPREDUCT-RXN]] | ||
+ | * [[DCDT]] | ||
+ | * [[RIBONUCLEOSIDE-DIP-REDUCTII-RXN]] | ||
+ | * [[RXN-12198]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[ATCM]] |
+ | * [[DOLICHOL-KINASE-RXN]] | ||
+ | * [[RXN-11832]] | ||
+ | * [[RXN-12195]] | ||
+ | * [[RXN-12959]] | ||
+ | * [[RXN-15091]] | ||
+ | * [[RXN-7683]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=cdp}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=zwiadyzpowuwew-xvfcmesisa-k}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=400.155}} |
Revision as of 09:23, 27 August 2019
Contents
Metabolite CDP
- common-name:
- cdp
- smiles:
- c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))op(op([o-])([o-])=o)([o-])=o
- inchi-key:
- zwiadyzpowuwew-xvfcmesisa-k
- molecular-weight:
- 400.155