Difference between revisions of "SJ06078"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALTOTRIOSE MALTOTRIOSE] == * common-name: ** maltotriose * smiles: ** c(c1(oc(c(c(c1o)o)o)oc2(...")
(Created page with "Category:gene == Gene SJ13527 == * transcription-direction: ** positive * right-end-position: ** 204672 * left-end-position: ** 197131 * centisome-position: ** 58.98629...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALTOTRIOSE MALTOTRIOSE] ==
+
== Gene SJ13527 ==
* common-name:
+
* transcription-direction:
** maltotriose
+
** positive
* smiles:
+
* right-end-position:
** c(c1(oc(c(c(c1o)o)o)oc2(c(oc(c(c2o)o)oc3(c(oc(c(c3o)o)o)co))co)))o
+
** 204672
* inchi-key:
+
* left-end-position:
** fygdtmlnykfzsv-dzoucchmsa-n
+
** 197131
* molecular-weight:
+
* centisome-position:
** 504.441
+
** 58.98629   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[RXN0-5183]]
+
* [[S.japonica_sterols_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
* [[RXN0-5182]]
+
* [[DIHYDLIPACETRANS-RXN]]
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
{{#set: common-name=maltotriose}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: inchi-key=inchikey=fygdtmlnykfzsv-dzoucchmsa-n}}
+
* [[RXN0-1133]]
{{#set: molecular-weight=504.441}}
+
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
== Pathway(s) associated ==
 +
* [[PYRUVDEHYD-PWY]]
 +
** '''3''' reactions found over '''3''' reactions in the full pathway
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=204672}}
 +
{{#set: left-end-position=197131}}
 +
{{#set: centisome-position=58.98629    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=2}}
 +
{{#set: nb pathway associated=1}}

Revision as of 20:19, 18 December 2020

Gene SJ13527

  • transcription-direction:
    • positive
  • right-end-position:
    • 204672
  • left-end-position:
    • 197131
  • centisome-position:
    • 58.98629

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated