Difference between revisions of "SJ06127"

Revision as of 09:24, 27 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14950 CPD-14950] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PRENAL PRENAL] ==
 * common-name:
-** 3-o-methylkaempferol
+** 3-methyl-2-butenal
 * smiles:
-** coc3(c(=o)c1(c(=cc(o)=cc(o)=1)oc(c2(c=cc(o)=cc=2))=3))
+** cc(=c[ch]=o)c
 * inchi-key:
-** vjjzjbucdwkplc-uhfffaoysa-n
+** sepqtyodoklvsb-uhfffaoysa-n
 * molecular-weight:
-** 300.267
+** 84.118
 == Reaction(s) known to consume the compound ==
+* [[1.5.99.12-RXN]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-13935]]
+* [[1.5.99.12-RXN]]
+* [[1.8.3.5-RXN]]
+* [[RXN-11989]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=3-o-methylkaempferol}}
+{{#set: common-name=3-methyl-2-butenal}}
-{{#set: inchi-key=inchikey=vjjzjbucdwkplc-uhfffaoysa-n}}
+{{#set: inchi-key=inchikey=sepqtyodoklvsb-uhfffaoysa-n}}
-{{#set: molecular-weight=300.267}}
+{{#set: molecular-weight=84.118}}