Difference between revisions of "SJ06150"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-196 CPD-196] == * common-name: ** octanoyl-coa * smiles: ** cccccccc(=o)sccnc(=o)ccnc(=o)c(...")
(Created page with "Category:gene == Gene SJ17350 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * RXN-12086 ** Category:...")
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-196 CPD-196] ==
+
== Gene SJ17350 ==
−
* common-name:
+
== Organism(s) associated with this gene  ==
−
** octanoyl-coa
+
* [[S.japonica_carotenoid_curated]]
−
* smiles:
+
== Reaction(s) associated ==
−
** cccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
* [[RXN-12086]]
−
* inchi-key:
+
** Category: [[orthology]]
−
** kqmzyoxobsxmii-cecatxlmsa-j
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
−
* molecular-weight:
+
* [[RXN-12579]]
−
** 889.7
+
** Category: [[orthology]]
−
== Reaction(s) known to consume the compound ==
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
−
* [[3.1.2.19-RXN-CPD-196/WATER//CPD-195/CO-A/PROTON.35.]]
+
* [[TRIACYLGLYCEROL-LIPASE-RXN]]
−
* [[ACACT4]]
+
** Category: [[orthology]]
−
* [[ACACT4h]]
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
−
* [[ACECOATRANS-RXN-CPD-196/ACET//CPD-195/ACETYL-COA.33.]]
+
== Pathway(s) associated ==
−
* [[ACOA80OR]]
+
* [[PWY-6857]]
−
* [[RXN-12669]]
+
** '''3''' reactions found over '''7''' reactions in the full pathway
−
* [[RXN-14229]]
+
* [[LIPAS-PWY]]
−
* [[THIOESTER-RXN[CCO-CYTOSOL]-CPD-196/WATER//CPD-195/CO-A/PROTON.48.]]
+
** '''2''' reactions found over '''3''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
{{#set: organism associated=S.japonica_carotenoid_curated}}
−
* [[ACACT4]]
+
{{#set: nb reaction associated=3}}
−
* [[R223-RXN]]
+
{{#set: nb pathway associated=2}}
−
* [[RXN-13617]]
 
−
* [[RXN-14229]]
 
−
== Reaction(s) of unknown directionality ==
 
−
{{#set: common-name=octanoyl-coa}}
 
−
{{#set: inchi-key=inchikey=kqmzyoxobsxmii-cecatxlmsa-j}}
 
−
{{#set: molecular-weight=889.7}}
 

Revision as of 09:25, 27 August 2019

Gene SJ17350

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-6857
    • 3 reactions found over 7 reactions in the full pathway
  • LIPAS-PWY
    • 2 reactions found over 3 reactions in the full pathway


Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ06150&oldid=29153"