Difference between revisions of "SJ06176"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-DIHYDROXY-PHENYLALANINE L-DIHYDROXY-PHENYLALANINE] == * common-name: ** l-dopa * smiles: ** c...")
(Created page with "Category:gene == Gene SJ06176 == * transcription-direction: ** positive * right-end-position: ** 555067 * left-end-position: ** 552244 * centisome-position: ** 59.304363...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-DIHYDROXY-PHENYLALANINE L-DIHYDROXY-PHENYLALANINE] ==
+
== Gene SJ06176 ==
* common-name:
+
* transcription-direction:
** l-dopa
+
** positive
* smiles:
+
* right-end-position:
** c(c(cc1(c=cc(o)=c(o)c=1))[n+])(=o)[o-]
+
** 555067
* inchi-key:
+
* left-end-position:
** wtdrdqbearuvnc-lurjtmiesa-n
+
** 552244
* molecular-weight:
+
* centisome-position:
** 197.19
+
** 59.304363   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[RXN-13061]]
+
* [[S.japonica_carotenoid_curated]]
* [[RXN-8460]]
+
== Reaction(s) associated ==
* [[RXN66-221]]
+
* [[RXN-15561]]
== Reaction(s) known to produce the compound ==
+
** Category: [[annotation]]
* [[RXN-5861]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
== Reaction(s) of unknown directionality ==
+
* [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
{{#set: common-name=l-dopa}}
+
** Category: [[annotation]]
{{#set: inchi-key=inchikey=wtdrdqbearuvnc-lurjtmiesa-n}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: molecular-weight=197.19}}
+
== Pathway(s) associated ==
 +
* [[PWY-7511]]
 +
** '''7''' reactions found over '''9''' reactions in the full pathway
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=555067}}
 +
{{#set: left-end-position=552244}}
 +
{{#set: centisome-position=59.304363    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=2}}
 +
{{#set: nb pathway associated=1}}

Latest revision as of 11:01, 18 March 2021

Gene SJ06176

  • transcription-direction:
    • positive
  • right-end-position:
    • 555067
  • left-end-position:
    • 552244
  • centisome-position:
    • 59.304363

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-7511
    • 7 reactions found over 9 reactions in the full pathway