Difference between revisions of "SJ06176"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-DEHYDRO-ASCORBATE L-DEHYDRO-ASCORBATE] == * common-name: ** l-dehydro-ascorbate * smiles: **...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-DIHYDROXY-PHENYLALANINE L-DIHYDROXY-PHENYLALANINE] == * common-name: ** l-dopa * smiles: ** c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-DIHYDROXY-PHENYLALANINE L-DIHYDROXY-PHENYLALANINE] == |
* common-name: | * common-name: | ||
| − | ** l- | + | ** l-dopa |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c(c(cc1(c=cc(o)=c(o)c=1))[n+])(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** wtdrdqbearuvnc-lurjtmiesa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 197.19 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-13061]] |
| − | * [[ | + | * [[RXN-8460]] |
| + | * [[RXN66-221]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-5861]] | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=l- | + | {{#set: common-name=l-dopa}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=wtdrdqbearuvnc-lurjtmiesa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=197.19}} |
Revision as of 14:19, 26 August 2019
Contents
Metabolite L-DIHYDROXY-PHENYLALANINE
- common-name:
- l-dopa
- smiles:
- c(c(cc1(c=cc(o)=c(o)c=1))[n+])(=o)[o-]
- inchi-key:
- wtdrdqbearuvnc-lurjtmiesa-n
- molecular-weight:
- 197.19
