Difference between revisions of "SJ06201"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ03174 == * transcription-direction: ** negative * right-end-position: ** 37192 * left-end-position: ** 27897 * centisome-position: ** 22.453398...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17313 CPD-17313] == * common-name: ** sapienoyl-coa * smiles: ** cccccccccc=cccccc(sccnc(=o...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ03174 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17313 CPD-17313] ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** sapienoyl-coa
−
* right-end-position:
+
* smiles:
−
** 37192
+
** cccccccccc=cccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
−
* left-end-position:
+
* inchi-key:
−
** 27897
+
** pvzuhjmomjkuef-hatlacbzsa-j
−
* centisome-position:
+
* molecular-weight:
−
** 22.453398   
+
** 999.899
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
−
== Reaction(s) associated ==
+
* [[RXN-16065]]
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
== Reaction(s) of unknown directionality ==
−
* [[3.1.1.64-RXN]]
+
{{#set: common-name=sapienoyl-coa}}
−
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=pvzuhjmomjkuef-hatlacbzsa-j}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=999.899}}
−
* [[CARBOXYLESTERASE-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[ISOLEUCINE--TRNA-LIGASE-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RETINYL-PALMITATE-ESTERASE-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-10711]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-10767]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-12252]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-12575]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXNQT-4366]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
</div>
 
−
== Pathway(s) associated ==
 
−
* [[TRNA-CHARGING-PWY]]
 
−
** '''21''' reactions found over '''21''' reactions in the full pathway
 
−
* [[PWY-6303]]
 
−
** '''1''' reactions found over '''2''' reactions in the full pathway
 
−
* [[PWY-6857]]
 
−
** '''3''' reactions found over '''7''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=37192}}
 
−
{{#set: left-end-position=27897}}
 
−
{{#set: centisome-position=22.453398    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=9}}
 
−
{{#set: nb pathway associated=3}}
 

Revision as of 14:20, 26 August 2019

Metabolite CPD-17313

  • common-name:
    • sapienoyl-coa
  • smiles:
    • cccccccccc=cccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
  • inchi-key:
    • pvzuhjmomjkuef-hatlacbzsa-j
  • molecular-weight:
    • 999.899

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ06201&oldid=16159"