Difference between revisions of "SJ06204"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIVINYLCHLOROPHYLLIDE-A DIVINYLCHLOROPHYLLIDE-A] == * smiles: ** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15661 CPD-15661] == * common-name: ** 2-trans, 4-trans-undecadienoyl-coa * smiles: ** ccccc...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15661 CPD-15661] == |
+ | * common-name: | ||
+ | ** 2-trans, 4-trans-undecadienoyl-coa | ||
* smiles: | * smiles: | ||
− | ** | + | ** ccccccc=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
− | * | + | * inchi-key: |
− | ** | + | ** szkpluulggerfd-msnzeopqsa-j |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 927.749 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-14790]] |
+ | * [[RXN-14791]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-14789]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=2-trans, 4-trans-undecadienoyl-coa}} |
− | {{#set: molecular-weight= | + | {{#set: inchi-key=inchikey=szkpluulggerfd-msnzeopqsa-j}} |
+ | {{#set: molecular-weight=927.749}} |
Revision as of 09:24, 27 August 2019
Contents
Metabolite CPD-15661
- common-name:
- 2-trans, 4-trans-undecadienoyl-coa
- smiles:
- ccccccc=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- szkpluulggerfd-msnzeopqsa-j
- molecular-weight:
- 927.749