Difference between revisions of "SJ06204"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIVINYLCHLOROPHYLLIDE-A DIVINYLCHLOROPHYLLIDE-A] == * smiles: ** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15661 CPD-15661] == * common-name: ** 2-trans, 4-trans-undecadienoyl-coa * smiles: ** ccccc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIVINYLCHLOROPHYLLIDE-A DIVINYLCHLOROPHYLLIDE-A] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15661 CPD-15661] ==
 +
* common-name:
 +
** 2-trans, 4-trans-undecadienoyl-coa
 
* smiles:
 
* smiles:
** c=cc2(c(c)=c4(c=c9(c(c)c(ccc(=o)[o-])c5(=n([mg]36(n1(=c(c(c=c)=c(c)c1=cc=2n34)c=c7(c(c)=c8(c(=o)[c-](c(oc)=o)c5=c(n67)8)))))9))))
+
** ccccccc=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
* common-name:
+
* inchi-key:
** 3,8-divinyl chlorophyllide a
+
** szkpluulggerfd-msnzeopqsa-j
 
* molecular-weight:
 
* molecular-weight:
** 610.951
+
** 927.749
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-5286]]
+
* [[RXN-14790]]
 +
* [[RXN-14791]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-5285]]
+
* [[RXN-14789]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3,8-divinyl chlorophyllide a}}
+
{{#set: common-name=2-trans, 4-trans-undecadienoyl-coa}}
{{#set: molecular-weight=610.951}}
+
{{#set: inchi-key=inchikey=szkpluulggerfd-msnzeopqsa-j}}
 +
{{#set: molecular-weight=927.749}}

Revision as of 09:24, 27 August 2019

Metabolite CPD-15661

  • common-name:
    • 2-trans, 4-trans-undecadienoyl-coa
  • smiles:
    • ccccccc=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • szkpluulggerfd-msnzeopqsa-j
  • molecular-weight:
    • 927.749

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality