Difference between revisions of "SJ06253"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12365 CPD-12365] == * common-name: ** 8-oxo-dgmp * smiles: ** c(op(=o)([o-])[o-])c1(oc(cc(o...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-Polyrenyl-benzene-1-2-diols 3-Polyrenyl-benzene-1-2-diols] == * common-name: ** a 3-(all-tran...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12365 CPD-12365] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-Polyrenyl-benzene-1-2-diols 3-Polyrenyl-benzene-1-2-diols] ==
 
* common-name:
 
* common-name:
** 8-oxo-dgmp
+
** a 3-(all-trans-polyrenyl)benzene-1,2-diol
* smiles:
 
** c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c(=o)nc2(c(=o)nc(n)=nc=23)))
 
* inchi-key:
 
** aqivlflyhyfrku-vpeninkcsa-l
 
* molecular-weight:
 
** 361.207
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14205]]
+
* [[RXN-12160]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11396]]
 
* [[RXN-12816]]
 
* [[RXN-14205]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=8-oxo-dgmp}}
+
{{#set: common-name=a 3-(all-trans-polyrenyl)benzene-1,2-diol}}
{{#set: inchi-key=inchikey=aqivlflyhyfrku-vpeninkcsa-l}}
 
{{#set: molecular-weight=361.207}}
 

Revision as of 14:20, 26 August 2019

Metabolite 3-Polyrenyl-benzene-1-2-diols

  • common-name:
    • a 3-(all-trans-polyrenyl)benzene-1,2-diol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality