Difference between revisions of "SJ06297"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14407 CPD-14407] == * common-name: ** dihomo γ-linolenoyl-coa * smiles: ** cccccc=ccc...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PALMITYL-COA PALMITYL-COA] == * common-name: ** palmitoyl-coa * smiles: ** cccccccccccccccc(scc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14407 CPD-14407] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PALMITYL-COA PALMITYL-COA] ==
 
* common-name:
 
* common-name:
** dihomo γ-linolenoyl-coa
+
** palmitoyl-coa
 
* smiles:
 
* smiles:
** cccccc=ccc=ccc=cccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cccccccccccccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
* inchi-key:
 
* inchi-key:
** fjwjalrunnzibb-ddquopdjsa-j
+
** mnbkluuykpbkdu-bbecnahfsa-j
 
* molecular-weight:
 
* molecular-weight:
** 1051.975
+
** 1001.915
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13435]]
+
* [[ACOA160OR]]
* [[RXN-16044]]
+
* [[CARNITINE-O-PALMITOYLTRANSFERASE-RXN]]
 +
* [[PALMITOYL-COA-HYDROLASE-RXN]]
 +
* [[RXN-10664]]
 +
* [[RXN-11026-PALMITYL-COA/OXYGEN-MOLECULE//CPD0-2117/HYDROGEN-PEROXIDE.58.]]
 +
* [[RXN-12547]]
 +
* [[RXN-14554]]
 +
* [[RXN-15066]]
 +
* [[RXN-16032]]
 +
* [[RXN-16065]]
 +
* [[RXN-9543]]
 +
* [[SERINE-C-PALMITOYLTRANSFERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12971]]
+
* [[CARNITINE-O-PALMITOYLTRANSFERASE-RXN]]
* [[RXN-17105]]
+
* [[RXN-15066]]
 +
* [[RXN-9623]]
 +
* [[RXN3O-9780]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dihomo γ-linolenoyl-coa}}
+
{{#set: common-name=palmitoyl-coa}}
{{#set: inchi-key=inchikey=fjwjalrunnzibb-ddquopdjsa-j}}
+
{{#set: inchi-key=inchikey=mnbkluuykpbkdu-bbecnahfsa-j}}
{{#set: molecular-weight=1051.975}}
+
{{#set: molecular-weight=1001.915}}

Revision as of 09:24, 27 August 2019

Metabolite PALMITYL-COA

  • common-name:
    • palmitoyl-coa
  • smiles:
    • cccccccccccccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
  • inchi-key:
    • mnbkluuykpbkdu-bbecnahfsa-j
  • molecular-weight:
    • 1001.915

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality