Difference between revisions of "SJ06326"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ARG-tRNAs ARG-tRNAs] == * common-name: ** a trnaarg == Reaction(s) known to consume the compoun...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8090 CPD-8090] == * common-name: ** 1-α-linolenoyl-2-linoleoyl-phosphatidylcholine *...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8090 CPD-8090] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 1-α-linolenoyl-2-linoleoyl-phosphatidylcholine |
| + | * smiles: | ||
| + | ** ccc=ccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccc=cccccc)cop([o-])(=o)occ[n+](c)(c)c)=o | ||
| + | * inchi-key: | ||
| + | ** qfdyidgukxrpkh-vslglsmxsa-n | ||
| + | * molecular-weight: | ||
| + | ** 780.076 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-8331]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-8323]] | |
| − | + | * [[RXN-8330]] | |
| − | |||
| − | * [[RXN- | ||
| − | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1-α-linolenoyl-2-linoleoyl-phosphatidylcholine}} |
| + | {{#set: inchi-key=inchikey=qfdyidgukxrpkh-vslglsmxsa-n}} | ||
| + | {{#set: molecular-weight=780.076}} | ||
Revision as of 09:24, 27 August 2019
Contents
Metabolite CPD-8090
- common-name:
- 1-α-linolenoyl-2-linoleoyl-phosphatidylcholine
- smiles:
- ccc=ccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccc=cccccc)cop([o-])(=o)occ[n+](c)(c)c)=o
- inchi-key:
- qfdyidgukxrpkh-vslglsmxsa-n
- molecular-weight:
- 780.076
