Difference between revisions of "SJ06359"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5662 CPD-5662] == * common-name: ** 9-mercaptodethiobiotin * smiles: ** c(s)c1(c(nc(n1)=o)c...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PLASTOQUINONE PLASTOQUINONE] == * common-name: ** a plastoquinone == Reaction(s) known to consu...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5662 CPD-5662] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PLASTOQUINONE PLASTOQUINONE] ==
 
* common-name:
 
* common-name:
** 9-mercaptodethiobiotin
+
** a plastoquinone
* smiles:
 
** c(s)c1(c(nc(n1)=o)cccccc(=o)[o-])
 
* inchi-key:
 
** zarfdbykhcotrh-uhfffaoysa-m
 
* molecular-weight:
 
** 245.316
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17473]]
+
* [[PSII-RXN]]
 +
* [[RXN-11355]]
 +
* [[RXN-12243]]
 +
* [[RXN-12244]]
 +
* [[RXN-12303]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17472]]
+
* [[RXN-12303]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=9-mercaptodethiobiotin}}
+
{{#set: common-name=a plastoquinone}}
{{#set: inchi-key=inchikey=zarfdbykhcotrh-uhfffaoysa-m}}
 
{{#set: molecular-weight=245.316}}
 

Revision as of 14:19, 26 August 2019

Metabolite PLASTOQUINONE

  • common-name:
    • a plastoquinone

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality