Difference between revisions of "SJ06382"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17385 CPD-17385] == * common-name: ** (6z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa * smil...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3187 CPD-3187] == * common-name: ** 2'-hydroxynicotine * smiles: ** c1(ccc(o)([n+](c)1)c2(=...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17385 CPD-17385] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3187 CPD-3187] ==
 
* common-name:
 
* common-name:
** (6z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa
+
** 2'-hydroxynicotine
 
* smiles:
 
* smiles:
** ccc=ccc=ccc=ccc=ccc=ccc=cccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
+
** c1(ccc(o)([n+](c)1)c2(=cn=cc=c2))
 
* inchi-key:
 
* inchi-key:
** krifzirxaaithr-kwfbmmabsa-j
+
** boqrppfuushfgw-snvbaglbsa-o
 
* molecular-weight:
 
* molecular-weight:
** 1102.034
+
** 179.241
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16134]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16132]]
+
* [[RXN66-146]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(6z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa}}
+
{{#set: common-name=2'-hydroxynicotine}}
{{#set: inchi-key=inchikey=krifzirxaaithr-kwfbmmabsa-j}}
+
{{#set: inchi-key=inchikey=boqrppfuushfgw-snvbaglbsa-o}}
{{#set: molecular-weight=1102.034}}
+
{{#set: molecular-weight=179.241}}

Revision as of 14:19, 26 August 2019

Metabolite CPD-3187

  • common-name:
    • 2'-hydroxynicotine
  • smiles:
    • c1(ccc(o)([n+](c)1)c2(=cn=cc=c2))
  • inchi-key:
    • boqrppfuushfgw-snvbaglbsa-o
  • molecular-weight:
    • 179.241

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality