Difference between revisions of "SJ06410"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19151 CPD-19151] == * common-name: ** (s)-3-hydroxy-(5z)-dodecenoyl-coa * smiles: ** cccccc...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-341 CPD0-341] == * common-name: ** s-succinyl-dihydrolipoamide * smiles: ** c(n)(=o)ccccc(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19151 CPD-19151] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-341 CPD0-341] ==
 
* common-name:
 
* common-name:
** (s)-3-hydroxy-(5z)-dodecenoyl-coa
+
** s-succinyl-dihydrolipoamide
 
* smiles:
 
* smiles:
** ccccccc=ccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c(n)(=o)ccccc(sc(=o)ccc(=o)[o-])ccs
 
* inchi-key:
 
* inchi-key:
** ayordfmyybnsbo-qccsjadrsa-j
+
** rjcjwoncskshes-vifpvbqesa-m
 
* molecular-weight:
 
* molecular-weight:
** 959.791
+
** 306.414
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17798]]
+
* [[AKGDHe2r]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17797]]
+
* [[AKGDHe2r]]
 +
* [[AKGDHmi]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(s)-3-hydroxy-(5z)-dodecenoyl-coa}}
+
{{#set: common-name=s-succinyl-dihydrolipoamide}}
{{#set: inchi-key=inchikey=ayordfmyybnsbo-qccsjadrsa-j}}
+
{{#set: inchi-key=inchikey=rjcjwoncskshes-vifpvbqesa-m}}
{{#set: molecular-weight=959.791}}
+
{{#set: molecular-weight=306.414}}

Revision as of 14:19, 26 August 2019

Metabolite CPD0-341

  • common-name:
    • s-succinyl-dihydrolipoamide
  • smiles:
    • c(n)(=o)ccccc(sc(=o)ccc(=o)[o-])ccs
  • inchi-key:
    • rjcjwoncskshes-vifpvbqesa-m
  • molecular-weight:
    • 306.414

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality