Difference between revisions of "SJ06410"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-341 CPD0-341] == * common-name: ** s-succinyl-dihydrolipoamide * smiles: ** c(n)(=o)ccccc(...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SELENOHOMOCYSTEINE SELENOHOMOCYSTEINE] == * common-name: ** seleno-l-homocysteine * smiles: **...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-341 CPD0-341] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SELENOHOMOCYSTEINE SELENOHOMOCYSTEINE] ==
 
* common-name:
 
* common-name:
** s-succinyl-dihydrolipoamide
+
** seleno-l-homocysteine
 
* smiles:
 
* smiles:
** c(n)(=o)ccccc(sc(=o)ccc(=o)[o-])ccs
+
** c(c[se])c([n+])c(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** rjcjwoncskshes-vifpvbqesa-m
+
** rcwcglalnciqnm-vkhmyheasa-n
 
* molecular-weight:
 
* molecular-weight:
** 306.414
+
** 182.081
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[AKGDHe2r]]
+
* [[RXN-12730]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[AKGDHe2r]]
+
* [[RXN-12729]]
* [[AKGDHmi]]
+
* [[RXN-15137]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=s-succinyl-dihydrolipoamide}}
+
{{#set: common-name=seleno-l-homocysteine}}
{{#set: inchi-key=inchikey=rjcjwoncskshes-vifpvbqesa-m}}
+
{{#set: inchi-key=inchikey=rcwcglalnciqnm-vkhmyheasa-n}}
{{#set: molecular-weight=306.414}}
+
{{#set: molecular-weight=182.081}}

Revision as of 09:23, 27 August 2019

Metabolite SELENOHOMOCYSTEINE

  • common-name:
    • seleno-l-homocysteine
  • smiles:
    • c(c[se])c([n+])c(=o)[o-]
  • inchi-key:
    • rcwcglalnciqnm-vkhmyheasa-n
  • molecular-weight:
    • 182.081

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality