Difference between revisions of "SJ06413"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-ALPHA-HYDROXYETHYL-THPP 2-ALPHA-HYDROXYETHYL-THPP] == * common-name: ** 2-(α-hydroxyeth...")
(Created page with "Category:gene == Gene SJ06413 == * transcription-direction: ** negative * right-end-position: ** 59422 * left-end-position: ** 37368 * centisome-position: ** 7.85075 =...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-ALPHA-HYDROXYETHYL-THPP 2-ALPHA-HYDROXYETHYL-THPP] ==
+
== Gene SJ06413 ==
−
* common-name:
+
* transcription-direction:
−
** 2-(α-hydroxyethyl)thiamine diphosphate
+
** negative
−
* smiles:
+
* right-end-position:
−
** cc2(=c(sc(c(c)o)=[n+](cc1(c=nc(c)=nc(n)=1))2)ccop(=o)([o-])op(=o)([o-])[o-])
+
** 59422
−
* inchi-key:
+
* left-end-position:
−
** rruvjgasjonmdy-uhfffaoysa-l
+
** 37368
−
* molecular-weight:
+
* centisome-position:
−
** 466.341
+
** 7.85075   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[PDHam2hi]]
+
* [[S.japonica_carotenoid_curated]]
−
* [[PDHam2mi]]
+
== Reaction(s) associated ==
−
* [[RXN-12508]]
+
* [[3.1.6.12-RXN]]
−
* [[RXN-14037]]
+
** Category: [[annotation]]
−
== Reaction(s) known to produce the compound ==
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[RXN-12583]]
+
* [[ARYLSULFAT-RXN]]
−
* [[RXN-14037]]
+
** Category: [[annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: common-name=2-(α-hydroxyethyl)thiamine diphosphate}}
+
{{#set: transcription-direction=negative}}
−
{{#set: inchi-key=inchikey=rruvjgasjonmdy-uhfffaoysa-l}}
+
{{#set: right-end-position=59422}}
−
{{#set: molecular-weight=466.341}}
+
{{#set: left-end-position=37368}}
 +
{{#set: centisome-position=7.85075    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=2}}

Latest revision as of 11:02, 18 March 2021

Gene SJ06413

  • transcription-direction:
    • negative
  • right-end-position:
    • 59422
  • left-end-position:
    • 37368
  • centisome-position:
    • 7.85075

Organism(s) associated with this gene

Reaction(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ06413&oldid=132532"