Difference between revisions of "SJ06442"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUTACONYL-COA GLUTACONYL-COA] == * common-name: ** (e)-glutaconyl-coa * smiles: ** cc(c)(c(o)c...")
(Created page with "Category:gene == Gene SJ06442 == * transcription-direction: ** positive * right-end-position: ** 187205 * left-end-position: ** 186762 * centisome-position: ** 39.276394...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUTACONYL-COA GLUTACONYL-COA] ==
+
== Gene SJ06442 ==
−
* common-name:
+
* transcription-direction:
−
** (e)-glutaconyl-coa
+
** positive
−
* smiles:
+
* right-end-position:
−
** cc(c)(c(o)c(=o)nccc(=o)nccsc(c=ccc(=o)[o-])=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** 187205
−
* inchi-key:
+
* left-end-position:
−
** urtlotisfjppou-degqqwijsa-i
+
** 186762
−
* molecular-weight:
+
* centisome-position:
−
** 874.579
+
** 39.276394   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[GLUTACONYL-COA-DECARBOXYLASE-RXN]]
+
* [[S.japonica_carotenoid_curated]]
−
* [[GLUTARYL-COA-DEHYDROG-RXN]]
+
== Reaction(s) associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[2.1.1.135-RXN]]
−
* [[GLUTACONYL-COA-DECARBOXYLASE-RXN]]
+
** Category: [[annotation]]
−
* [[GLUTARYL-COA-DEHYDROG-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
== Reaction(s) of unknown directionality ==
+
* [[CYTOCHROME-B5-REDUCTASE-RXN]]
−
{{#set: common-name=(e)-glutaconyl-coa}}
+
** Category: [[annotation]]
−
{{#set: inchi-key=inchikey=urtlotisfjppou-degqqwijsa-i}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: molecular-weight=874.579}}
+
* [[IRON--CYTOCHROME-C-REDUCTASE-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[NADPH--FERRIHEMOPROTEIN-REDUCTASE-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[R621-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[RXN-11195]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=187205}}
 +
{{#set: left-end-position=186762}}
 +
{{#set: centisome-position=39.276394    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=6}}

Latest revision as of 11:01, 18 March 2021

Gene SJ06442

  • transcription-direction:
    • positive
  • right-end-position:
    • 187205
  • left-end-position:
    • 186762
  • centisome-position:
    • 39.276394

Organism(s) associated with this gene

Reaction(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ06442&oldid=132110"