Difference between revisions of "SJ06452"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8091 CPD-8091] == * common-name: ** 1-oleoyl-2-linoleoyl-phosphatidylcholine * smiles: ** c...")
(Created page with "Category:gene == Gene SJ02308 == * transcription-direction: ** negative * right-end-position: ** 23125 * left-end-position: ** 20058 * centisome-position: ** 14.469565...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8091 CPD-8091] ==
+
== Gene SJ02308 ==
* common-name:
+
* transcription-direction:
** 1-oleoyl-2-linoleoyl-phosphatidylcholine
+
** negative
* smiles:
+
* right-end-position:
** ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccc=cccccc)cop([o-])(=o)occ[n+](c)(c)c)=o
+
** 23125
* inchi-key:
+
* left-end-position:
** gdwulugdxghjij-vjhnmzkjsa-n
+
** 20058
* molecular-weight:
+
* centisome-position:
** 784.107
+
** 14.469565   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[RXN-8322]]
+
* [[S.japonica_sterols_curated]]
* [[RXN-8326]]
+
== Reaction(s) associated ==
== Reaction(s) known to produce the compound ==
+
* [[RXN-12456]]
* [[RXN-8327]]
+
** Category: [[annotation]]
== Reaction(s) of unknown directionality ==
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: common-name=1-oleoyl-2-linoleoyl-phosphatidylcholine}}
+
* [[RXN0-1281]]
{{#set: inchi-key=inchikey=gdwulugdxghjij-vjhnmzkjsa-n}}
+
** Category: [[orthology]]
{{#set: molecular-weight=784.107}}
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=23125}}
 +
{{#set: left-end-position=20058}}
 +
{{#set: centisome-position=14.469565    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=2}}

Revision as of 20:22, 18 December 2020

Gene SJ02308

  • transcription-direction:
    • negative
  • right-end-position:
    • 23125
  • left-end-position:
    • 20058
  • centisome-position:
    • 14.469565

Organism(s) associated with this gene

Reaction(s) associated