Difference between revisions of "SJ06590"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ22548 == * transcription-direction: ** positive * right-end-position: ** 139039 * left-end-position: ** 120966 * centisome-position: ** 69.77372...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHORIBOSYL-FORMAMIDO-CARBOXAMIDE PHOSPHORIBOSYL-FORMAMIDO-CARBOXAMIDE] == * common-name: **...")
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ22548 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHORIBOSYL-FORMAMIDO-CARBOXAMIDE PHOSPHORIBOSYL-FORMAMIDO-CARBOXAMIDE] ==
* transcription-direction:
+
* common-name:
** positive
+
** 5-formamido-1-(5-phospho-d-ribosyl)-imidazole-4-carboxamide
* right-end-position:
+
* smiles:
** 139039
+
** c(op([o-])(=o)[o-])c2(c(o)c(o)c(n1(c=nc(c(=o)n)=c(nc=o)1))o2)
* left-end-position:
+
* inchi-key:
** 120966
+
** abcooorlyaoboz-kqynxxcusa-l
* centisome-position:
+
* molecular-weight:
** 69.77372   
+
** 364.208
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[AICARTRANSFORM-RXN]]
== Reaction(s) associated ==
+
* [[FPAIF]]
* [[2.7.12.1-RXN]]
+
* [[IMPCYCLOHYDROLASE-RXN]]
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[AICARTRANSFORM-RXN]]
* [[PROTEIN-KINASE-RXN]]
+
* [[FPAIF]]
** Category: [[annotation]]
+
* [[IMPCYCLOHYDROLASE-RXN]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
* [[RXN-14906]]
+
{{#set: common-name=5-formamido-1-(5-phospho-d-ribosyl)-imidazole-4-carboxamide}}
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=abcooorlyaoboz-kqynxxcusa-l}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=364.208}}
{{#set: transcription-direction=positive}}
 
{{#set: right-end-position=139039}}
 
{{#set: left-end-position=120966}}
 
{{#set: centisome-position=69.77372    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=3}}
 

Revision as of 09:25, 27 August 2019

Metabolite PHOSPHORIBOSYL-FORMAMIDO-CARBOXAMIDE

  • common-name:
    • 5-formamido-1-(5-phospho-d-ribosyl)-imidazole-4-carboxamide
  • smiles:
    • c(op([o-])(=o)[o-])c2(c(o)c(o)c(n1(c=nc(c(=o)n)=c(nc=o)1))o2)
  • inchi-key:
    • abcooorlyaoboz-kqynxxcusa-l
  • molecular-weight:
    • 364.208

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality