Difference between revisions of "SJ06590"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHORIBOSYL-FORMAMIDO-CARBOXAMIDE PHOSPHORIBOSYL-FORMAMIDO-CARBOXAMIDE] == * common-name: **...")
(Created page with "Category:gene == Gene SJ02725 == * transcription-direction: ** negative * right-end-position: ** 79587 * left-end-position: ** 70657 * centisome-position: ** 13.223699...")
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHORIBOSYL-FORMAMIDO-CARBOXAMIDE PHOSPHORIBOSYL-FORMAMIDO-CARBOXAMIDE] ==
+
== Gene SJ02725 ==
−
* common-name:
+
* transcription-direction:
−
** 5-formamido-1-(5-phospho-d-ribosyl)-imidazole-4-carboxamide
+
** negative
−
* smiles:
+
* right-end-position:
−
** c(op([o-])(=o)[o-])c2(c(o)c(o)c(n1(c=nc(c(=o)n)=c(nc=o)1))o2)
+
** 79587
−
* inchi-key:
+
* left-end-position:
−
** abcooorlyaoboz-kqynxxcusa-l
+
** 70657
−
* molecular-weight:
+
* centisome-position:
−
** 364.208
+
** 13.223699   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[AICARTRANSFORM-RXN]]
+
* [[S.japonica_sterols_curated]]
−
* [[FPAIF]]
+
== Reaction(s) associated ==
−
* [[IMPCYCLOHYDROLASE-RXN]]
+
* [[2.7.10.1-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Category: [[annotation]]
−
* [[AICARTRANSFORM-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[FPAIF]]
+
* [[2.7.12.1-RXN]]
−
* [[IMPCYCLOHYDROLASE-RXN]]
+
** Category: [[annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: common-name=5-formamido-1-(5-phospho-d-ribosyl)-imidazole-4-carboxamide}}
+
* [[PROTEIN-KINASE-RXN]]
−
{{#set: inchi-key=inchikey=abcooorlyaoboz-kqynxxcusa-l}}
+
** Category: [[annotation]]
−
{{#set: molecular-weight=364.208}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[RXN-14906]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=79587}}
 +
{{#set: left-end-position=70657}}
 +
{{#set: centisome-position=13.223699    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=4}}

Revision as of 20:22, 18 December 2020

Gene SJ02725

  • transcription-direction:
    • negative
  • right-end-position:
    • 79587
  • left-end-position:
    • 70657
  • centisome-position:
    • 13.223699

Organism(s) associated with this gene

Reaction(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ06590&oldid=42210"