Difference between revisions of "SJ06625"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12173 CPD-12173] == * common-name: ** (s)-3-hydroxy-isobutanoyl-coa * smiles: ** cc(c(=o)sc...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Sugar-Phosphate Sugar-Phosphate] == * common-name: ** a sugar phosphate == Reaction(s) known to...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12173 CPD-12173] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Sugar-Phosphate Sugar-Phosphate] ==
 
* common-name:
 
* common-name:
** (s)-3-hydroxy-isobutanoyl-coa
+
** a sugar phosphate
* smiles:
 
** cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])co
 
* inchi-key:
 
** wweogfzefhpuam-uqcjfraesa-j
 
* molecular-weight:
 
** 849.593
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3-HYDROXYISOBUTYRYL-COA-HYDROLASE-RXN]]
+
* [[SUGAR-PHOSPHATASE-RXN]]
* [[METHYLACYLYLCOA-HYDROXY-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[METHYLACYLYLCOA-HYDROXY-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(s)-3-hydroxy-isobutanoyl-coa}}
+
{{#set: common-name=a sugar phosphate}}
{{#set: inchi-key=inchikey=wweogfzefhpuam-uqcjfraesa-j}}
 
{{#set: molecular-weight=849.593}}
 

Revision as of 14:19, 26 August 2019

Metabolite Sugar-Phosphate

  • common-name:
    • a sugar phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality