Difference between revisions of "SJ06627"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ09533 == * transcription-direction: ** positive * right-end-position: ** 408320 * left-end-position: ** 407118 * centisome-position: ** 98.711784...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12902 CPD-12902] == * common-name: ** 5-methylhex-4-enoyl-coa * smiles: ** cc(c)=cccc(=o)sc...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12902 CPD-12902] == |
− | * | + | * common-name: |
− | ** | + | ** 5-methylhex-4-enoyl-coa |
− | * | + | * smiles: |
− | ** | + | ** cc(c)=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
− | * | + | * inchi-key: |
− | ** | + | ** beyylhumfmwplh-svhodsnwsa-j |
− | * | + | * molecular-weight: |
− | ** | + | ** 873.658 |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | == Reaction(s) | + | * [[RXN-11917]] |
− | * [[ | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=5-methylhex-4-enoyl-coa}} | |
− | + | {{#set: inchi-key=inchikey=beyylhumfmwplh-svhodsnwsa-j}} | |
− | {{#set: | + | {{#set: molecular-weight=873.658}} |
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− |
Revision as of 09:25, 27 August 2019
Contents
Metabolite CPD-12902
- common-name:
- 5-methylhex-4-enoyl-coa
- smiles:
- cc(c)=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- beyylhumfmwplh-svhodsnwsa-j
- molecular-weight:
- 873.658