Difference between revisions of "SJ06627"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ09533 == * transcription-direction: ** positive * right-end-position: ** 408320 * left-end-position: ** 407118 * centisome-position: ** 98.711784...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12902 CPD-12902] == * common-name: ** 5-methylhex-4-enoyl-coa * smiles: ** cc(c)=cccc(=o)sc...")
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ09533 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12902 CPD-12902] ==
* transcription-direction:
+
* common-name:
** positive
+
** 5-methylhex-4-enoyl-coa
* right-end-position:
+
* smiles:
** 408320
+
** cc(c)=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
* left-end-position:
+
* inchi-key:
** 407118
+
** beyylhumfmwplh-svhodsnwsa-j
* centisome-position:
+
* molecular-weight:
** 98.711784   
+
** 873.658
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
== Reaction(s) associated ==
+
* [[RXN-11917]]
* [[DNA-CYTOSINE-5--METHYLTRANSFERASE-RXN]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=5-methylhex-4-enoyl-coa}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=beyylhumfmwplh-svhodsnwsa-j}}
{{#set: transcription-direction=positive}}
+
{{#set: molecular-weight=873.658}}
{{#set: right-end-position=408320}}
 
{{#set: left-end-position=407118}}
 
{{#set: centisome-position=98.711784    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=1}}
 

Revision as of 09:25, 27 August 2019

Metabolite CPD-12902

  • common-name:
    • 5-methylhex-4-enoyl-coa
  • smiles:
    • cc(c)=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • beyylhumfmwplh-svhodsnwsa-j
  • molecular-weight:
    • 873.658

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality