Difference between revisions of "SJ06647"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13172 CPD-13172] == * common-name: ** 6-hydroxy-2-cyclohexen-one-carboxylate * smiles: ** c...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Malonyl-acp-methyl-ester Malonyl-acp-methyl-ester] == * common-name: ** a malonyl-[acp] methyl...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13172 CPD-13172] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Malonyl-acp-methyl-ester Malonyl-acp-methyl-ester] ==
 
* common-name:
 
* common-name:
** 6-hydroxy-2-cyclohexen-one-carboxylate
+
** a malonyl-[acp] methyl ester
* smiles:
 
** c(=o)(c1(o)(c=cccc(=o)1))[o-]
 
* inchi-key:
 
** wezwwzkubqcmbl-uhfffaoysa-m
 
* molecular-weight:
 
** 155.13
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-11474]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12252]]
+
* [[RXN-11475]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=6-hydroxy-2-cyclohexen-one-carboxylate}}
+
{{#set: common-name=a malonyl-[acp] methyl ester}}
{{#set: inchi-key=inchikey=wezwwzkubqcmbl-uhfffaoysa-m}}
 
{{#set: molecular-weight=155.13}}
 

Revision as of 14:19, 26 August 2019

Metabolite Malonyl-acp-methyl-ester

  • common-name:
    • a malonyl-[acp] methyl ester

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a malonyl-[acp] methyl ester" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.