Difference between revisions of "SJ06720"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TRANS-3-METHYL-GLUTACONYL-COA TRANS-3-METHYL-GLUTACONYL-COA] == * common-name: ** 3-methylgluta...")
(Created page with "Category:gene == Gene SJ06720 == * transcription-direction: ** positive * right-end-position: ** 29534 * left-end-position: ** 27245 * centisome-position: ** 5.772319...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TRANS-3-METHYL-GLUTACONYL-COA TRANS-3-METHYL-GLUTACONYL-COA] ==
+
== Gene SJ06720 ==
−
* common-name:
+
* transcription-direction:
−
** 3-methylglutaconyl-coa
+
** positive
−
* smiles:
+
* right-end-position:
−
** cc(=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])cc(=o)[o-]
+
** 29534
−
* inchi-key:
+
* left-end-position:
−
** gxkshrdahflwpn-rkylshmcsa-i
+
** 27245
−
* molecular-weight:
+
* centisome-position:
−
** 888.606
+
** 5.772319   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
== Reaction(s) known to produce the compound ==
+
* [[S.japonica_carotenoid_curated]]
−
* [[METHYLCROTONYL-COA-CARBOXYLASE-RXN]]
+
== Reaction(s) associated ==
−
== Reaction(s) of unknown directionality ==
+
* [[5.3.4.1-RXN]]
−
{{#set: common-name=3-methylglutaconyl-coa}}
+
** Category: [[annotation]]
−
{{#set: inchi-key=inchikey=gxkshrdahflwpn-rkylshmcsa-i}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: molecular-weight=888.606}}
+
* [[DISULISOM-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=29534}}
 +
{{#set: left-end-position=27245}}
 +
{{#set: centisome-position=5.772319    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=2}}

Latest revision as of 11:03, 18 March 2021

Gene SJ06720

  • transcription-direction:
    • positive
  • right-end-position:
    • 29534
  • left-end-position:
    • 27245
  • centisome-position:
    • 5.772319

Organism(s) associated with this gene

Reaction(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ06720&oldid=132863"