Difference between revisions of "SJ06726"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7524 CPD-7524] == * common-name: ** 7,9,9'-cis-neurosporene * smiles: ** cc(=cccc(=cc=cc(c)...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UROCANATE UROCANATE] == * common-name: ** urocanate * smiles: ** c1(nc=nc=1c=cc([o-])=o) * inch...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7524 CPD-7524] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UROCANATE UROCANATE] ==
 
* common-name:
 
* common-name:
** 7,9,9'-cis-neurosporene
+
** urocanate
 
* smiles:
 
* smiles:
** cc(=cccc(=cc=cc(c)=cc=cc(=cc=cc=c(c=cc=c(c)ccc=c(ccc=c(c)c)c)c)c)c)c
+
** c1(nc=nc=1c=cc([o-])=o)
 
* inchi-key:
 
* inchi-key:
** atcicvfrsjqydv-ifjqppewsa-n
+
** loiymiarkyctbw-owojbtedsa-m
 
* molecular-weight:
 
* molecular-weight:
** 538.898
+
** 137.118
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11357]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11356]]
+
* [[HISTIDINE-AMMONIA-LYASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=7,9,9'-cis-neurosporene}}
+
{{#set: common-name=urocanate}}
{{#set: inchi-key=inchikey=atcicvfrsjqydv-ifjqppewsa-n}}
+
{{#set: inchi-key=inchikey=loiymiarkyctbw-owojbtedsa-m}}
{{#set: molecular-weight=538.898}}
+
{{#set: molecular-weight=137.118}}

Revision as of 09:23, 27 August 2019

Metabolite UROCANATE

  • common-name:
    • urocanate
  • smiles:
    • c1(nc=nc=1c=cc([o-])=o)
  • inchi-key:
    • loiymiarkyctbw-owojbtedsa-m
  • molecular-weight:
    • 137.118

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality