Difference between revisions of "SJ06726"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=STEARIC_ACID STEARIC_ACID] == * common-name: ** stearate * smiles: ** cccccccccccccccccc(=o)[o-...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7524 CPD-7524] == * common-name: ** 7,9,9'-cis-neurosporene * smiles: ** cc(=cccc(=cc=cc(c)...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7524 CPD-7524] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 7,9,9'-cis-neurosporene |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(=cccc(=cc=cc(c)=cc=cc(=cc=cc=c(c=cc=c(c)ccc=c(ccc=c(c)c)c)c)c)c)c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** atcicvfrsjqydv-ifjqppewsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 538.898 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-11357]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-11356]] | |
| − | * [[RXN- | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=7,9,9'-cis-neurosporene}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=atcicvfrsjqydv-ifjqppewsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=538.898}} |
Revision as of 14:19, 26 August 2019
Contents
Metabolite CPD-7524
- common-name:
- 7,9,9'-cis-neurosporene
- smiles:
- cc(=cccc(=cc=cc(c)=cc=cc(=cc=cc=c(c=cc=c(c)ccc=c(ccc=c(c)c)c)c)c)c)c
- inchi-key:
- atcicvfrsjqydv-ifjqppewsa-n
- molecular-weight:
- 538.898
