Difference between revisions of "SJ06731"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4203 CPD-4203] == * common-name: ** n6-(δ2-isopentenyl)-adenosine 5'-diphosphate * sm...")
(Created page with "Category:gene == Gene SJ06731 == * transcription-direction: ** negative * right-end-position: ** 14971 * left-end-position: ** 32 * centisome-position: ** 4.083299300e-2 =...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4203 CPD-4203] ==
+
== Gene SJ06731 ==
−
* common-name:
+
* transcription-direction:
−
** n6-(δ2-isopentenyl)-adenosine 5'-diphosphate
+
** negative
−
* smiles:
+
* right-end-position:
−
** cc(=ccnc3(=nc=nc2(n(c1(c(c(c(o1)cop(op(=o)([o-])[o-])([o-])=o)o)o))c=nc=23)))c
+
** 14971
−
* inchi-key:
+
* left-end-position:
−
** vxmxkdahjurhen-sdbhatresa-k
+
** 32
−
* molecular-weight:
+
* centisome-position:
−
** 492.298
+
** 4.083299300e-2
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[RXN-4311]]
+
* [[S.japonica_carotenoid_curated]]
−
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
−
* [[RXN-4305]]
+
* [[3.1.3.16-RXN]]
−
* [[RXN-4311]]
+
** Category: [[annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: common-name=n6-(δ2-isopentenyl)-adenosine 5'-diphosphate}}
+
* [[4-NITROPHENYLPHOSPHATASE-RXN]]
−
{{#set: inchi-key=inchikey=vxmxkdahjurhen-sdbhatresa-k}}
+
** Category: [[annotation]]
−
{{#set: molecular-weight=492.298}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[PROTEIN-KINASE-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=14971}}
 +
{{#set: left-end-position=32}}
 +
{{#set: centisome-position=4.083299300e-2}}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=3}}

Latest revision as of 11:02, 18 March 2021

Gene SJ06731

  • transcription-direction:
    • negative
  • right-end-position:
    • 14971
  • left-end-position:
    • 32
  • centisome-position:
    • 4.083299300e-2

Organism(s) associated with this gene

Reaction(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ06731&oldid=132501"