Difference between revisions of "SJ06731"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Donor-H2 Donor-H2] == * common-name: ** a reduced electron acceptor == Reaction(s) known to con...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4203 CPD-4203] == * common-name: ** n6-(δ2-isopentenyl)-adenosine 5'-diphosphate * sm...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4203 CPD-4203] == |
* common-name: | * common-name: | ||
− | ** | + | ** n6-(δ2-isopentenyl)-adenosine 5'-diphosphate |
+ | * smiles: | ||
+ | ** cc(=ccnc3(=nc=nc2(n(c1(c(c(c(o1)cop(op(=o)([o-])[o-])([o-])=o)o)o))c=nc=23)))c | ||
+ | * inchi-key: | ||
+ | ** vxmxkdahjurhen-sdbhatresa-k | ||
+ | * molecular-weight: | ||
+ | ** 492.298 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | + | * [[RXN-4311]] | |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * [[ | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | + | * [[RXN-4305]] | |
− | + | * [[RXN-4311]] | |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * [[RXN- | ||
− | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=n6-(δ2-isopentenyl)-adenosine 5'-diphosphate}} |
+ | {{#set: inchi-key=inchikey=vxmxkdahjurhen-sdbhatresa-k}} | ||
+ | {{#set: molecular-weight=492.298}} |
Revision as of 09:24, 27 August 2019
Contents
Metabolite CPD-4203
- common-name:
- n6-(δ2-isopentenyl)-adenosine 5'-diphosphate
- smiles:
- cc(=ccnc3(=nc=nc2(n(c1(c(c(c(o1)cop(op(=o)([o-])[o-])([o-])=o)o)o))c=nc=23)))c
- inchi-key:
- vxmxkdahjurhen-sdbhatresa-k
- molecular-weight:
- 492.298