Difference between revisions of "SJ06734"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ITP ITP] == * common-name: ** itp * smiles: ** c(op(=o)([o-])op([o-])(=o)op([o-])([o-])=o)c1(oc...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Sulfurylated-ThiI Sulfurylated-ThiI] == * common-name: ** a [thii sulfur-carrier protein]-s-sul...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ITP ITP] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Sulfurylated-ThiI Sulfurylated-ThiI] ==
 
* common-name:
 
* common-name:
** itp
+
** a [thii sulfur-carrier protein]-s-sulfanyl-l-cysteine
* smiles:
 
** c(op(=o)([o-])op([o-])(=o)op([o-])([o-])=o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23)))
 
* inchi-key:
 
** haejpqiatwhalx-kqynxxcusa-j
 
* molecular-weight:
 
** 504.137
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ATP-DEAMINASE-RXN]]
+
* [[RXN-9787]]
* [[ITCY]]
 
* [[ITPP]]
 
* [[ITUP]]
 
* [[RXN-14120]]
 
* [[RXN0-5073]]
 
* [[RXN0-6382]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ATID]]
+
* [[RXN-14382]]
* [[ATIDm]]
+
* [[RXN-9787]]
* [[ATP-DEAMINASE-RXN]]
 
* [[RXN-14120]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=itp}}
+
{{#set: common-name=a [thii sulfur-carrier protein]-s-sulfanyl-l-cysteine}}
{{#set: inchi-key=inchikey=haejpqiatwhalx-kqynxxcusa-j}}
 
{{#set: molecular-weight=504.137}}
 

Revision as of 09:24, 27 August 2019

Metabolite Sulfurylated-ThiI

  • common-name:
    • a [thii sulfur-carrier protein]-s-sulfanyl-l-cysteine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [thii sulfur-carrier protein]-s-sulfanyl-l-cysteine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.