Difference between revisions of "SJ06735"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MANNITOL-1P MANNITOL-1P] == * common-name: ** d-mannitol 1-phosphate * smiles: ** c(c(c(c(c(cop...")
(Created page with "Category:gene == Gene SJ06735 == * transcription-direction: ** positive * right-end-position: ** 71918 * left-end-position: ** 39016 * centisome-position: ** 51.415997...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MANNITOL-1P MANNITOL-1P] ==
+
== Gene SJ06735 ==
* common-name:
+
* transcription-direction:
** d-mannitol 1-phosphate
+
** positive
* smiles:
+
* right-end-position:
** c(c(c(c(c(cop([o-])([o-])=o)o)o)o)o)o
+
** 71918
* inchi-key:
+
* left-end-position:
** gactwzzmvmukng-kvtdhhqdsa-l
+
** 39016
* molecular-weight:
+
* centisome-position:
** 260.137
+
** 51.415997   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[MANNITOL-1-PHOSPHATASE-RXN]]
+
* [[S.japonica_carotenoid_curated]]
* [[MANNPDEHYDROG-RXN]]
+
== Reaction(s) associated ==
== Reaction(s) known to produce the compound ==
+
* [[DNA-DIRECTED-RNA-POLYMERASE-RXN]]
* [[MANNPDEHYDROG-RXN]]
+
** Category: [[annotation]]
== Reaction(s) of unknown directionality ==
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: common-name=d-mannitol 1-phosphate}}
+
** Category: [[orthology]]
{{#set: inchi-key=inchikey=gactwzzmvmukng-kvtdhhqdsa-l}}
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
{{#set: molecular-weight=260.137}}
+
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=71918}}
 +
{{#set: left-end-position=39016}}
 +
{{#set: centisome-position=51.415997    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=1}}

Latest revision as of 11:03, 18 March 2021

Gene SJ06735

  • transcription-direction:
    • positive
  • right-end-position:
    • 71918
  • left-end-position:
    • 39016
  • centisome-position:
    • 51.415997

Organism(s) associated with this gene

Reaction(s) associated