Difference between revisions of "SJ06735"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MANNITOL-1P MANNITOL-1P] == * common-name: ** d-mannitol 1-phosphate * smiles: ** c(c(c(c(c(cop...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9406 CPD-9406] == * common-name: ** (2s)-ethylmalonyl-coa * smiles: ** ccc(c(sccnc(=o)ccnc(...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9406 CPD-9406] == |
* common-name: | * common-name: | ||
− | ** | + | ** (2s)-ethylmalonyl-coa |
* smiles: | * smiles: | ||
− | ** c(c(c(c(c( | + | ** ccc(c(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)c([o-])=o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** vugzqvcbbbezqe-uqcjfraesa-i |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 876.595 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-13029]] |
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-13029]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(2s)-ethylmalonyl-coa}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=vugzqvcbbbezqe-uqcjfraesa-i}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=876.595}} |
Revision as of 09:24, 27 August 2019
Contents
Metabolite CPD-9406
- common-name:
- (2s)-ethylmalonyl-coa
- smiles:
- ccc(c(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)c([o-])=o
- inchi-key:
- vugzqvcbbbezqe-uqcjfraesa-i
- molecular-weight:
- 876.595