Difference between revisions of "SJ06815"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-ACETYLCARNITINE O-ACETYLCARNITINE] == * common-name: ** o-acetyl-l-carnitine * smiles: ** cc(...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=a-pyruvate-dehydrogenase-E2-protein-Nsup a-pyruvate-dehydrogenase-E2-protein-Nsup] == * common-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-ACETYLCARNITINE O-ACETYLCARNITINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=a-pyruvate-dehydrogenase-E2-protein-Nsup a-pyruvate-dehydrogenase-E2-protein-Nsup] ==
 
* common-name:
 
* common-name:
** o-acetyl-l-carnitine
+
** a [pyruvate dehydrogenase e2 protein] n6-octanoyl-l-lysine
* smiles:
 
** cc(=o)oc(cc(=o)[o-])c[n+](c)(c)c
 
* inchi-key:
 
** rdhqfkqigngied-mrvpvssysa-n
 
* molecular-weight:
 
** 203.238
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[CARNITINE-O-ACETYLTRANSFERASE-RXN]]
+
* [[RXN-14957]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[CARNITINE-O-ACETYLTRANSFERASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=o-acetyl-l-carnitine}}
+
{{#set: common-name=a [pyruvate dehydrogenase e2 protein] n6-octanoyl-l-lysine}}
{{#set: inchi-key=inchikey=rdhqfkqigngied-mrvpvssysa-n}}
 
{{#set: molecular-weight=203.238}}
 

Revision as of 09:24, 27 August 2019

Metabolite a-pyruvate-dehydrogenase-E2-protein-Nsup

  • common-name:
    • a [pyruvate dehydrogenase e2 protein] n6-octanoyl-l-lysine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [pyruvate dehydrogenase e2 protein] n6-octanoyl-l-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.