Difference between revisions of "SJ06882"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-596 CPD-596] == * common-name: ** n6,n6-dimethyl-l-arginine * smiles: ** cn(c(=[n+])ncccc([...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12365 CPD-12365] == * common-name: ** 8-oxo-dgmp * smiles: ** c(op(=o)([o-])[o-])c1(oc(cc(o...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12365 CPD-12365] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 8-oxo-dgmp |
* smiles: | * smiles: | ||
| − | ** | + | ** c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c(=o)nc2(c(=o)nc(n)=nc=23))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** aqivlflyhyfrku-vpeninkcsa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 361.207 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-14205]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-11396]] | ||
| + | * [[RXN-12816]] | ||
| + | * [[RXN-14205]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=8-oxo-dgmp}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=aqivlflyhyfrku-vpeninkcsa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=361.207}} |
Revision as of 09:25, 27 August 2019
Contents
Metabolite CPD-12365
- common-name:
- 8-oxo-dgmp
- smiles:
- c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c(=o)nc2(c(=o)nc(n)=nc=23)))
- inchi-key:
- aqivlflyhyfrku-vpeninkcsa-l
- molecular-weight:
- 361.207
